About 1-phenyl-3-(pyrido[2,3-b]pyrazin-6-ylamino)pyrrolidin-2-one
1-phenyl-3-(pyrido[2,3-b]pyrazin-6-ylamino)pyrrolidin-2-one (PubChem CID 75370344) has the molecular formula C17H15N5O
and a molecular weight of 305.34 g/mol. Its IUPAC name is 1-phenyl-3-(pyrido[2,3-b]pyrazin-6-ylamino)pyrrolidin-2-one.
Molecular Properties
| Compound Name | 1-phenyl-3-(pyrido[2,3-b]pyrazin-6-ylamino)pyrrolidin-2-one |
| PubChem CID | 75370344 |
| Molecular Formula | C17H15N5O |
| Molecular Weight | 305.34 g/mol |
| Exact Mass | 305.13 |
| IUPAC Name | 1-phenyl-3-(pyrido[2,3-b]pyrazin-6-ylamino)pyrrolidin-2-one |
| SMILES | O=C1C(Nc2ccc3nccnc3n2)CCN1c1ccccc1 |
| InChI | InChI=1S/C17H15N5O/c23-17-14(8-11-22(17)12-4-2-1-3-5-12)20-15-7-6-13-16(21-15)19-10-9-18-13/h1-7,9-10,14H,8,11H2,(H,19,20,21) |
| InChIKey | RJBHJLBIXZKRCB-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 71.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 305.34 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-phenyl-3-(pyrido[2,3-b]pyrazin-6-ylamino)pyrrolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-phenyl-3-(pyrido[2,3-b]pyrazin-6-ylamino)pyrrolidin-2-one?
The IUPAC name of 1-phenyl-3-(pyrido[2,3-b]pyrazin-6-ylamino)pyrrolidin-2-one (CID 75370344) is 1-phenyl-3-(pyrido[2,3-b]pyrazin-6-ylamino)pyrrolidin-2-one.
What is the SMILES notation for 1-phenyl-3-(pyrido[2,3-b]pyrazin-6-ylamino)pyrrolidin-2-one?
The canonical SMILES for 1-phenyl-3-(pyrido[2,3-b]pyrazin-6-ylamino)pyrrolidin-2-one is O=C1C(Nc2ccc3nccnc3n2)CCN1c1ccccc1.
What is the InChIKey of 1-phenyl-3-(pyrido[2,3-b]pyrazin-6-ylamino)pyrrolidin-2-one?
The InChIKey is RJBHJLBIXZKRCB-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H15N5O/c23-17-14(8-11-22(17)12-4-2-1-3-5-12)20-15-7-6-13-16(21-15)19-10-9-18-13/h1-7,9-10,14H,8,11H2,(H,19,20,21).
What are the key properties of 1-phenyl-3-(pyrido[2,3-b]pyrazin-6-ylamino)pyrrolidin-2-one?
1-phenyl-3-(pyrido[2,3-b]pyrazin-6-ylamino)pyrrolidin-2-one has a molecular weight of 305.34 g/mol, XLogP of 2.24, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-phenyl-3-(pyrido[2,3-b]pyrazin-6-ylamino)pyrrolidin-2-one is sourced from PubChem (CID 75370344), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).