About 1,3,6-trimethyl-5-(4-nitrobenzoyl)pyrimidine-2,4-dione
1,3,6-trimethyl-5-(4-nitrobenzoyl)pyrimidine-2,4-dione (PubChem CID 753706) has the molecular formula C14H13N3O5
and a molecular weight of 303.27 g/mol. Its IUPAC name is 1,3,6-trimethyl-5-(4-nitrobenzoyl)pyrimidine-2,4-dione.
Molecular Properties
| Compound Name | 1,3,6-trimethyl-5-(4-nitrobenzoyl)pyrimidine-2,4-dione |
| PubChem CID | 753706 |
| Molecular Formula | C14H13N3O5 |
| Molecular Weight | 303.27 g/mol |
| Exact Mass | 303.09 |
| IUPAC Name | 1,3,6-trimethyl-5-(4-nitrobenzoyl)pyrimidine-2,4-dione |
| SMILES | Cc1c(C(=O)c2ccc([N+](=O)[O-])cc2)c(=O)n(C)c(=O)n1C |
| InChI | InChI=1S/C14H13N3O5/c1-8-11(13(19)16(3)14(20)15(8)2)12(18)9-4-6-10(7-5-9)17(21)22/h4-7H,1-3H3 |
| InChIKey | FPXONXPIBRSJNJ-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 104.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.27 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1,3,6-trimethyl-5-(4-nitrobenzoyl)pyrimidine-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3,6-trimethyl-5-(4-nitrobenzoyl)pyrimidine-2,4-dione?
The IUPAC name of 1,3,6-trimethyl-5-(4-nitrobenzoyl)pyrimidine-2,4-dione (CID 753706) is 1,3,6-trimethyl-5-(4-nitrobenzoyl)pyrimidine-2,4-dione.
What is the SMILES notation for 1,3,6-trimethyl-5-(4-nitrobenzoyl)pyrimidine-2,4-dione?
The canonical SMILES for 1,3,6-trimethyl-5-(4-nitrobenzoyl)pyrimidine-2,4-dione is Cc1c(C(=O)c2ccc([N+](=O)[O-])cc2)c(=O)n(C)c(=O)n1C.
What is the InChIKey of 1,3,6-trimethyl-5-(4-nitrobenzoyl)pyrimidine-2,4-dione?
The InChIKey is FPXONXPIBRSJNJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H13N3O5/c1-8-11(13(19)16(3)14(20)15(8)2)12(18)9-4-6-10(7-5-9)17(21)22/h4-7H,1-3H3.
What are the key properties of 1,3,6-trimethyl-5-(4-nitrobenzoyl)pyrimidine-2,4-dione?
1,3,6-trimethyl-5-(4-nitrobenzoyl)pyrimidine-2,4-dione has a molecular weight of 303.27 g/mol, XLogP of 0.53, 3 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3,6-trimethyl-5-(4-nitrobenzoyl)pyrimidine-2,4-dione is sourced from PubChem (CID 753706), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).