About N-[cyano-(3,5-dichlorophenyl)methyl]-2-(2-methoxyethoxy)acetamide
N-[cyano-(3,5-dichlorophenyl)methyl]-2-(2-methoxyethoxy)acetamide (PubChem CID 75371266) has the molecular formula C13H14Cl2N2O3
and a molecular weight of 317.17 g/mol. Its IUPAC name is N-[cyano-(3,5-dichlorophenyl)methyl]-2-(2-methoxyethoxy)acetamide.
Molecular Properties
| Compound Name | N-[cyano-(3,5-dichlorophenyl)methyl]-2-(2-methoxyethoxy)acetamide |
| PubChem CID | 75371266 |
| Molecular Formula | C13H14Cl2N2O3 |
| Molecular Weight | 317.17 g/mol |
| Exact Mass | 316.04 |
| IUPAC Name | N-[cyano-(3,5-dichlorophenyl)methyl]-2-(2-methoxyethoxy)acetamide |
| SMILES | COCCOCC(=O)NC(C#N)c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C13H14Cl2N2O3/c1-19-2-3-20-8-13(18)17-12(7-16)9-4-10(14)6-11(15)5-9/h4-6,12H,2-3,8H2,1H3,(H,17,18) |
| InChIKey | PWEUQJLWKZCEEY-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 71.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.17 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-[cyano-(3,5-dichlorophenyl)methyl]-2-(2-methoxyethoxy)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[cyano-(3,5-dichlorophenyl)methyl]-2-(2-methoxyethoxy)acetamide?
The IUPAC name of N-[cyano-(3,5-dichlorophenyl)methyl]-2-(2-methoxyethoxy)acetamide (CID 75371266) is N-[cyano-(3,5-dichlorophenyl)methyl]-2-(2-methoxyethoxy)acetamide.
What is the SMILES notation for N-[cyano-(3,5-dichlorophenyl)methyl]-2-(2-methoxyethoxy)acetamide?
The canonical SMILES for N-[cyano-(3,5-dichlorophenyl)methyl]-2-(2-methoxyethoxy)acetamide is COCCOCC(=O)NC(C#N)c1cc(Cl)cc(Cl)c1.
What is the InChIKey of N-[cyano-(3,5-dichlorophenyl)methyl]-2-(2-methoxyethoxy)acetamide?
The InChIKey is PWEUQJLWKZCEEY-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14Cl2N2O3/c1-19-2-3-20-8-13(18)17-12(7-16)9-4-10(14)6-11(15)5-9/h4-6,12H,2-3,8H2,1H3,(H,17,18).
What are the key properties of N-[cyano-(3,5-dichlorophenyl)methyl]-2-(2-methoxyethoxy)acetamide?
N-[cyano-(3,5-dichlorophenyl)methyl]-2-(2-methoxyethoxy)acetamide has a molecular weight of 317.17 g/mol, XLogP of 2.34, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[cyano-(3,5-dichlorophenyl)methyl]-2-(2-methoxyethoxy)acetamide is sourced from PubChem (CID 75371266), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).