C18H18N8 — CID 75371370
6-[4-(3-phenyl-1H-1,2,4-triazol-5-yl)piperidin-1-yl]-7H-purine (PubChem CID 75371370) has the molecular formula C18H18N8 and a molecular weight of 346.40 g/mol. Its IUPAC name is 6-[4-(3-phenyl-1H-1,2,4-triazol-5-yl)piperidin-1-yl]-7H-purine.
| Compound Name | 6-[4-(3-phenyl-1H-1,2,4-triazol-5-yl)piperidin-1-yl]-7H-purine |
|---|---|
| PubChem CID | 75371370 |
| Molecular Formula | C18H18N8 |
| Molecular Weight | 346.40 g/mol |
| Exact Mass | 346.17 |
| IUPAC Name | 6-[4-(3-phenyl-1H-1,2,4-triazol-5-yl)piperidin-1-yl]-7H-purine |
| SMILES | c1ccc(-c2n[nH]c(C3CCN(c4ncnc5nc[nH]c45)CC3)n2)cc1 |
| InChI | InChI=1S/C18H18N8/c1-2-4-12(5-3-1)15-23-16(25-24-15)13-6-8-26(9-7-13)18-14-17(20-10-19-14)21-11-22-18/h1-5,10-11,13H,6-9H2,(H,23,24,25)(H,19,20,21,22) |
| InChIKey | YPFQEQOBKLLJFQ-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 99.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.40 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |