C22H23N3O2S2 — CID 75371409
N-[3-[bis(thiophen-2-ylmethyl)carbamoylamino]-4-methylphenyl]cyclopropanecarboxamide (PubChem CID 75371409) has the molecular formula C22H23N3O2S2 and a molecular weight of 425.58 g/mol. Its IUPAC name is N-[3-[bis(thiophen-2-ylmethyl)carbamoylamino]-4-methylphenyl]cyclopropanecarboxamide.
| Compound Name | N-[3-[bis(thiophen-2-ylmethyl)carbamoylamino]-4-methylphenyl]cyclopropanecarboxamide |
|---|---|
| PubChem CID | 75371409 |
| Molecular Formula | C22H23N3O2S2 |
| Molecular Weight | 425.58 g/mol |
| Exact Mass | 425.12 |
| IUPAC Name | N-[3-[bis(thiophen-2-ylmethyl)carbamoylamino]-4-methylphenyl]cyclopropanecarboxamide |
| SMILES | Cc1ccc(NC(=O)C2CC2)cc1NC(=O)N(Cc1cccs1)Cc1cccs1 |
| InChI | InChI=1S/C22H23N3O2S2/c1-15-6-9-17(23-21(26)16-7-8-16)12-20(15)24-22(27)25(13-18-4-2-10-28-18)14-19-5-3-11-29-19/h2-6,9-12,16H,7-8,13-14H2,1H3,(H,23,26)(H,24,27) |
| InChIKey | IOSBCYWILPYXRY-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.58 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |