C18H19FN2O4 — CID 75372446
2-[[4-[2-(3-fluorophenyl)acetyl]piperazin-1-yl]methyl]-5-hydroxypyran-4-one (PubChem CID 75372446) has the molecular formula C18H19FN2O4 and a molecular weight of 346.36 g/mol. Its IUPAC name is 2-[[4-[2-(3-fluorophenyl)acetyl]piperazin-1-yl]methyl]-5-hydroxypyran-4-one.
| Compound Name | 2-[[4-[2-(3-fluorophenyl)acetyl]piperazin-1-yl]methyl]-5-hydroxypyran-4-one |
|---|---|
| PubChem CID | 75372446 |
| Molecular Formula | C18H19FN2O4 |
| Molecular Weight | 346.36 g/mol |
| Exact Mass | 346.13 |
| IUPAC Name | 2-[[4-[2-(3-fluorophenyl)acetyl]piperazin-1-yl]methyl]-5-hydroxypyran-4-one |
| SMILES | O=C(Cc1cccc(F)c1)N1CCN(Cc2cc(=O)c(O)co2)CC1 |
| InChI | InChI=1S/C18H19FN2O4/c19-14-3-1-2-13(8-14)9-18(24)21-6-4-20(5-7-21)11-15-10-16(22)17(23)12-25-15/h1-3,8,10,12,23H,4-7,9,11H2 |
| InChIKey | HNEHOAIBOAUERH-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 73.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.36 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |