C14H27NO2 — CID 75372902
2-[2-(8-methyl-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)ethoxy]ethanol (PubChem CID 75372902) has the molecular formula C14H27NO2 and a molecular weight of 241.37 g/mol. Its IUPAC name is 2-[2-(8-methyl-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)ethoxy]ethanol.
| Compound Name | 2-[2-(8-methyl-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)ethoxy]ethanol |
|---|---|
| PubChem CID | 75372902 |
| Molecular Formula | C14H27NO2 |
| Molecular Weight | 241.37 g/mol |
| Exact Mass | 241.20 |
| IUPAC Name | 2-[2-(8-methyl-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)ethoxy]ethanol |
| SMILES | CC1CCCC2CCCN(CCOCCO)C12 |
| InChI | InChI=1S/C14H27NO2/c1-12-4-2-5-13-6-3-7-15(14(12)13)8-10-17-11-9-16/h12-14,16H,2-11H2,1H3 |
| InChIKey | DIQSSKRPKSIJJD-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.37 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|