About 1-(7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-yl)-3-(oxolan-2-ylmethyl)-1-propylurea
1-(7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-yl)-3-(oxolan-2-ylmethyl)-1-propylurea (PubChem CID 75373155) has the molecular formula C17H30N2O3
and a molecular weight of 310.44 g/mol. Its IUPAC name is 1-(7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-yl)-3-(oxolan-2-ylmethyl)-1-propylurea.
Molecular Properties
| Compound Name | 1-(7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-yl)-3-(oxolan-2-ylmethyl)-1-propylurea |
| PubChem CID | 75373155 |
| Molecular Formula | C17H30N2O3 |
| Molecular Weight | 310.44 g/mol |
| Exact Mass | 310.23 |
| IUPAC Name | 1-(7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-yl)-3-(oxolan-2-ylmethyl)-1-propylurea |
| SMILES | CCCN(C(=O)NCC1CCCO1)C1C2CCOC2C1(C)C |
| InChI | InChI=1S/C17H30N2O3/c1-4-8-19(16(20)18-11-12-6-5-9-21-12)14-13-7-10-22-15(13)17(14,2)3/h12-15H,4-11H2,1-3H3,(H,18,20) |
| InChIKey | XLYJEPFQWMOIRZ-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.44 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-yl)-3-(oxolan-2-ylmethyl)-1-propylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-yl)-3-(oxolan-2-ylmethyl)-1-propylurea?
The IUPAC name of 1-(7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-yl)-3-(oxolan-2-ylmethyl)-1-propylurea (CID 75373155) is 1-(7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-yl)-3-(oxolan-2-ylmethyl)-1-propylurea.
What is the SMILES notation for 1-(7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-yl)-3-(oxolan-2-ylmethyl)-1-propylurea?
The canonical SMILES for 1-(7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-yl)-3-(oxolan-2-ylmethyl)-1-propylurea is CCCN(C(=O)NCC1CCCO1)C1C2CCOC2C1(C)C.
What is the InChIKey of 1-(7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-yl)-3-(oxolan-2-ylmethyl)-1-propylurea?
The InChIKey is XLYJEPFQWMOIRZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H30N2O3/c1-4-8-19(16(20)18-11-12-6-5-9-21-12)14-13-7-10-22-15(13)17(14,2)3/h12-15H,4-11H2,1-3H3,(H,18,20).
What are the key properties of 1-(7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-yl)-3-(oxolan-2-ylmethyl)-1-propylurea?
1-(7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-yl)-3-(oxolan-2-ylmethyl)-1-propylurea has a molecular weight of 310.44 g/mol, XLogP of 2.40, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-yl)-3-(oxolan-2-ylmethyl)-1-propylurea is sourced from PubChem (CID 75373155), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).