About 3-(1-cyclopropyl-4,5-dimethylimidazol-2-yl)sulfanyl-1-(1-methylpyrazol-4-yl)piperidin-2-one
3-(1-cyclopropyl-4,5-dimethylimidazol-2-yl)sulfanyl-1-(1-methylpyrazol-4-yl)piperidin-2-one (PubChem CID 75373522) has the molecular formula C17H23N5OS
and a molecular weight of 345.47 g/mol. Its IUPAC name is 3-(1-cyclopropyl-4,5-dimethylimidazol-2-yl)sulfanyl-1-(1-methylpyrazol-4-yl)piperidin-2-one.
Molecular Properties
| Compound Name | 3-(1-cyclopropyl-4,5-dimethylimidazol-2-yl)sulfanyl-1-(1-methylpyrazol-4-yl)piperidin-2-one |
| PubChem CID | 75373522 |
| Molecular Formula | C17H23N5OS |
| Molecular Weight | 345.47 g/mol |
| Exact Mass | 345.16 |
| IUPAC Name | 3-(1-cyclopropyl-4,5-dimethylimidazol-2-yl)sulfanyl-1-(1-methylpyrazol-4-yl)piperidin-2-one |
| SMILES | Cc1nc(SC2CCCN(c3cnn(C)c3)C2=O)n(C2CC2)c1C |
| InChI | InChI=1S/C17H23N5OS/c1-11-12(2)22(13-6-7-13)17(19-11)24-15-5-4-8-21(16(15)23)14-9-18-20(3)10-14/h9-10,13,15H,4-8H2,1-3H3 |
| InChIKey | CYPLKIKPTFGSCX-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 55.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 345.47 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-(1-cyclopropyl-4,5-dimethylimidazol-2-yl)sulfanyl-1-(1-methylpyrazol-4-yl)piperidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(1-cyclopropyl-4,5-dimethylimidazol-2-yl)sulfanyl-1-(1-methylpyrazol-4-yl)piperidin-2-one?
The IUPAC name of 3-(1-cyclopropyl-4,5-dimethylimidazol-2-yl)sulfanyl-1-(1-methylpyrazol-4-yl)piperidin-2-one (CID 75373522) is 3-(1-cyclopropyl-4,5-dimethylimidazol-2-yl)sulfanyl-1-(1-methylpyrazol-4-yl)piperidin-2-one.
What is the SMILES notation for 3-(1-cyclopropyl-4,5-dimethylimidazol-2-yl)sulfanyl-1-(1-methylpyrazol-4-yl)piperidin-2-one?
The canonical SMILES for 3-(1-cyclopropyl-4,5-dimethylimidazol-2-yl)sulfanyl-1-(1-methylpyrazol-4-yl)piperidin-2-one is Cc1nc(SC2CCCN(c3cnn(C)c3)C2=O)n(C2CC2)c1C.
What is the InChIKey of 3-(1-cyclopropyl-4,5-dimethylimidazol-2-yl)sulfanyl-1-(1-methylpyrazol-4-yl)piperidin-2-one?
The InChIKey is CYPLKIKPTFGSCX-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H23N5OS/c1-11-12(2)22(13-6-7-13)17(19-11)24-15-5-4-8-21(16(15)23)14-9-18-20(3)10-14/h9-10,13,15H,4-8H2,1-3H3.
What are the key properties of 3-(1-cyclopropyl-4,5-dimethylimidazol-2-yl)sulfanyl-1-(1-methylpyrazol-4-yl)piperidin-2-one?
3-(1-cyclopropyl-4,5-dimethylimidazol-2-yl)sulfanyl-1-(1-methylpyrazol-4-yl)piperidin-2-one has a molecular weight of 345.47 g/mol, XLogP of 2.86, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(1-cyclopropyl-4,5-dimethylimidazol-2-yl)sulfanyl-1-(1-methylpyrazol-4-yl)piperidin-2-one is sourced from PubChem (CID 75373522), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).