C16H18Cl2N2O2 — CID 75373592
1-[2-(3,5-dichlorophenyl)cyclopropanecarbonyl]piperidine-2-carboxamide (PubChem CID 75373592) has the molecular formula C16H18Cl2N2O2 and a molecular weight of 341.24 g/mol. Its IUPAC name is 1-[2-(3,5-dichlorophenyl)cyclopropanecarbonyl]piperidine-2-carboxamide.
| Compound Name | 1-[2-(3,5-dichlorophenyl)cyclopropanecarbonyl]piperidine-2-carboxamide |
|---|---|
| PubChem CID | 75373592 |
| Molecular Formula | C16H18Cl2N2O2 |
| Molecular Weight | 341.24 g/mol |
| Exact Mass | 340.07 |
| IUPAC Name | 1-[2-(3,5-dichlorophenyl)cyclopropanecarbonyl]piperidine-2-carboxamide |
| SMILES | NC(=O)C1CCCCN1C(=O)C1CC1c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C16H18Cl2N2O2/c17-10-5-9(6-11(18)7-10)12-8-13(12)16(22)20-4-2-1-3-14(20)15(19)21/h5-7,12-14H,1-4,8H2,(H2,19,21) |
| InChIKey | RUCOSHWPLDJDDG-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.24 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |