C14H18F3N5 — CID 75373685
1-(1-methylpyrrol-2-yl)-N-[[8-(trifluoromethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-yl]methyl]methanamine (PubChem CID 75373685) has the molecular formula C14H18F3N5 and a molecular weight of 313.33 g/mol. Its IUPAC name is 1-(1-methylpyrrol-2-yl)-N-[[8-(trifluoromethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-yl]methyl]methanamine.
| Compound Name | 1-(1-methylpyrrol-2-yl)-N-[[8-(trifluoromethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-yl]methyl]methanamine |
|---|---|
| PubChem CID | 75373685 |
| Molecular Formula | C14H18F3N5 |
| Molecular Weight | 313.33 g/mol |
| Exact Mass | 313.15 |
| IUPAC Name | 1-(1-methylpyrrol-2-yl)-N-[[8-(trifluoromethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-yl]methyl]methanamine |
| SMILES | Cn1cccc1CNCc1nnc2n1CCCC2C(F)(F)F |
| InChI | InChI=1S/C14H18F3N5/c1-21-6-2-4-10(21)8-18-9-12-19-20-13-11(14(15,16)17)5-3-7-22(12)13/h2,4,6,11,18H,3,5,7-9H2,1H3 |
| InChIKey | MOKGGUQFYZJGJH-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 47.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.33 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |