About 3-cyano-4-[2-(2-ethyl-1,3-thiazol-4-yl)ethylamino]benzenesulfonamide
3-cyano-4-[2-(2-ethyl-1,3-thiazol-4-yl)ethylamino]benzenesulfonamide (PubChem CID 75374118) has the molecular formula C14H16N4O2S2
and a molecular weight of 336.44 g/mol. Its IUPAC name is 3-cyano-4-[2-(2-ethyl-1,3-thiazol-4-yl)ethylamino]benzenesulfonamide.
Molecular Properties
| Compound Name | 3-cyano-4-[2-(2-ethyl-1,3-thiazol-4-yl)ethylamino]benzenesulfonamide |
| PubChem CID | 75374118 |
| Molecular Formula | C14H16N4O2S2 |
| Molecular Weight | 336.44 g/mol |
| Exact Mass | 336.07 |
| IUPAC Name | 3-cyano-4-[2-(2-ethyl-1,3-thiazol-4-yl)ethylamino]benzenesulfonamide |
| SMILES | CCc1nc(CCNc2ccc(S(N)(=O)=O)cc2C#N)cs1 |
| InChI | InChI=1S/C14H16N4O2S2/c1-2-14-18-11(9-21-14)5-6-17-13-4-3-12(22(16,19)20)7-10(13)8-15/h3-4,7,9,17H,2,5-6H2,1H3,(H2,16,19,20) |
| InChIKey | FMTHSZAZMILDFM-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 108.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 336.44 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-cyano-4-[2-(2-ethyl-1,3-thiazol-4-yl)ethylamino]benzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-cyano-4-[2-(2-ethyl-1,3-thiazol-4-yl)ethylamino]benzenesulfonamide?
The IUPAC name of 3-cyano-4-[2-(2-ethyl-1,3-thiazol-4-yl)ethylamino]benzenesulfonamide (CID 75374118) is 3-cyano-4-[2-(2-ethyl-1,3-thiazol-4-yl)ethylamino]benzenesulfonamide.
What is the SMILES notation for 3-cyano-4-[2-(2-ethyl-1,3-thiazol-4-yl)ethylamino]benzenesulfonamide?
The canonical SMILES for 3-cyano-4-[2-(2-ethyl-1,3-thiazol-4-yl)ethylamino]benzenesulfonamide is CCc1nc(CCNc2ccc(S(N)(=O)=O)cc2C#N)cs1.
What is the InChIKey of 3-cyano-4-[2-(2-ethyl-1,3-thiazol-4-yl)ethylamino]benzenesulfonamide?
The InChIKey is FMTHSZAZMILDFM-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16N4O2S2/c1-2-14-18-11(9-21-14)5-6-17-13-4-3-12(22(16,19)20)7-10(13)8-15/h3-4,7,9,17H,2,5-6H2,1H3,(H2,16,19,20).
What are the key properties of 3-cyano-4-[2-(2-ethyl-1,3-thiazol-4-yl)ethylamino]benzenesulfonamide?
3-cyano-4-[2-(2-ethyl-1,3-thiazol-4-yl)ethylamino]benzenesulfonamide has a molecular weight of 336.44 g/mol, XLogP of 1.88, 6 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-cyano-4-[2-(2-ethyl-1,3-thiazol-4-yl)ethylamino]benzenesulfonamide is sourced from PubChem (CID 75374118), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).