About 4-(3,4-dihydro-1H-isothiochromene-1-carbonylamino)-1-methylpyrrole-2-carboxamide
4-(3,4-dihydro-1H-isothiochromene-1-carbonylamino)-1-methylpyrrole-2-carboxamide (PubChem CID 75374650) has the molecular formula C16H17N3O2S
and a molecular weight of 315.40 g/mol. Its IUPAC name is 4-(3,4-dihydro-1H-isothiochromene-1-carbonylamino)-1-methylpyrrole-2-carboxamide.
Molecular Properties
| Compound Name | 4-(3,4-dihydro-1H-isothiochromene-1-carbonylamino)-1-methylpyrrole-2-carboxamide |
| PubChem CID | 75374650 |
| Molecular Formula | C16H17N3O2S |
| Molecular Weight | 315.40 g/mol |
| Exact Mass | 315.10 |
| IUPAC Name | 4-(3,4-dihydro-1H-isothiochromene-1-carbonylamino)-1-methylpyrrole-2-carboxamide |
| SMILES | Cn1cc(NC(=O)C2SCCc3ccccc32)cc1C(N)=O |
| InChI | InChI=1S/C16H17N3O2S/c1-19-9-11(8-13(19)15(17)20)18-16(21)14-12-5-3-2-4-10(12)6-7-22-14/h2-5,8-9,14H,6-7H2,1H3,(H2,17,20)(H,18,21) |
| InChIKey | FYYOWAZNYQFUKK-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 77.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.40 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-(3,4-dihydro-1H-isothiochromene-1-carbonylamino)-1-methylpyrrole-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(3,4-dihydro-1H-isothiochromene-1-carbonylamino)-1-methylpyrrole-2-carboxamide?
The IUPAC name of 4-(3,4-dihydro-1H-isothiochromene-1-carbonylamino)-1-methylpyrrole-2-carboxamide (CID 75374650) is 4-(3,4-dihydro-1H-isothiochromene-1-carbonylamino)-1-methylpyrrole-2-carboxamide.
What is the SMILES notation for 4-(3,4-dihydro-1H-isothiochromene-1-carbonylamino)-1-methylpyrrole-2-carboxamide?
The canonical SMILES for 4-(3,4-dihydro-1H-isothiochromene-1-carbonylamino)-1-methylpyrrole-2-carboxamide is Cn1cc(NC(=O)C2SCCc3ccccc32)cc1C(N)=O.
What is the InChIKey of 4-(3,4-dihydro-1H-isothiochromene-1-carbonylamino)-1-methylpyrrole-2-carboxamide?
The InChIKey is FYYOWAZNYQFUKK-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H17N3O2S/c1-19-9-11(8-13(19)15(17)20)18-16(21)14-12-5-3-2-4-10(12)6-7-22-14/h2-5,8-9,14H,6-7H2,1H3,(H2,17,20)(H,18,21).
What are the key properties of 4-(3,4-dihydro-1H-isothiochromene-1-carbonylamino)-1-methylpyrrole-2-carboxamide?
4-(3,4-dihydro-1H-isothiochromene-1-carbonylamino)-1-methylpyrrole-2-carboxamide has a molecular weight of 315.40 g/mol, XLogP of 2.09, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3,4-dihydro-1H-isothiochromene-1-carbonylamino)-1-methylpyrrole-2-carboxamide is sourced from PubChem (CID 75374650), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).