About 4-(2-methoxyethyl)-6,6-dimethyl-1-propan-2-ylpiperazin-2-one
4-(2-methoxyethyl)-6,6-dimethyl-1-propan-2-ylpiperazin-2-one (PubChem CID 75374977) has the molecular formula C12H24N2O2
and a molecular weight of 228.34 g/mol. Its IUPAC name is 4-(2-methoxyethyl)-6,6-dimethyl-1-propan-2-ylpiperazin-2-one.
Molecular Properties
| Compound Name | 4-(2-methoxyethyl)-6,6-dimethyl-1-propan-2-ylpiperazin-2-one |
| PubChem CID | 75374977 |
| Molecular Formula | C12H24N2O2 |
| Molecular Weight | 228.34 g/mol |
| Exact Mass | 228.18 |
| IUPAC Name | 4-(2-methoxyethyl)-6,6-dimethyl-1-propan-2-ylpiperazin-2-one |
| SMILES | COCCN1CC(=O)N(C(C)C)C(C)(C)C1 |
| InChI | InChI=1S/C12H24N2O2/c1-10(2)14-11(15)8-13(6-7-16-5)9-12(14,3)4/h10H,6-9H2,1-5H3 |
| InChIKey | FEERCUJEIWGXRF-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.34 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-(2-methoxyethyl)-6,6-dimethyl-1-propan-2-ylpiperazin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2-methoxyethyl)-6,6-dimethyl-1-propan-2-ylpiperazin-2-one?
The IUPAC name of 4-(2-methoxyethyl)-6,6-dimethyl-1-propan-2-ylpiperazin-2-one (CID 75374977) is 4-(2-methoxyethyl)-6,6-dimethyl-1-propan-2-ylpiperazin-2-one.
What is the SMILES notation for 4-(2-methoxyethyl)-6,6-dimethyl-1-propan-2-ylpiperazin-2-one?
The canonical SMILES for 4-(2-methoxyethyl)-6,6-dimethyl-1-propan-2-ylpiperazin-2-one is COCCN1CC(=O)N(C(C)C)C(C)(C)C1.
What is the InChIKey of 4-(2-methoxyethyl)-6,6-dimethyl-1-propan-2-ylpiperazin-2-one?
The InChIKey is FEERCUJEIWGXRF-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H24N2O2/c1-10(2)14-11(15)8-13(6-7-16-5)9-12(14,3)4/h10H,6-9H2,1-5H3.
What are the key properties of 4-(2-methoxyethyl)-6,6-dimethyl-1-propan-2-ylpiperazin-2-one?
4-(2-methoxyethyl)-6,6-dimethyl-1-propan-2-ylpiperazin-2-one has a molecular weight of 228.34 g/mol, XLogP of 0.96, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-methoxyethyl)-6,6-dimethyl-1-propan-2-ylpiperazin-2-one is sourced from PubChem (CID 75374977), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).