C14H23N5O2 — CID 75375125
2-[[3-(1-ethoxyethyl)-1,2,4-oxadiazol-5-yl]methyl]-1,3-bis(prop-2-enyl)guanidine (PubChem CID 75375125) has the molecular formula C14H23N5O2 and a molecular weight of 293.37 g/mol. Its IUPAC name is 2-[[3-(1-ethoxyethyl)-1,2,4-oxadiazol-5-yl]methyl]-1,3-bis(prop-2-enyl)guanidine.
| Compound Name | 2-[[3-(1-ethoxyethyl)-1,2,4-oxadiazol-5-yl]methyl]-1,3-bis(prop-2-enyl)guanidine |
|---|---|
| PubChem CID | 75375125 |
| Molecular Formula | C14H23N5O2 |
| Molecular Weight | 293.37 g/mol |
| Exact Mass | 293.19 |
| IUPAC Name | 2-[[3-(1-ethoxyethyl)-1,2,4-oxadiazol-5-yl]methyl]-1,3-bis(prop-2-enyl)guanidine |
| SMILES | C=CCNC(=NCc1nc(C(C)OCC)no1)NCC=C |
| InChI | InChI=1S/C14H23N5O2/c1-5-8-15-14(16-9-6-2)17-10-12-18-13(19-21-12)11(4)20-7-3/h5-6,11H,1-2,7-10H2,3-4H3,(H2,15,16,17) |
| InChIKey | FTPXXXFMAKBYQJ-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 84.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.37 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|