C17H16N4O2S — CID 75375699
N-(2-methyl-5,6,7,8-tetrahydroquinazolin-5-yl)-2-sulfanylidene-3H-1,3-benzoxazole-6-carboxamide (PubChem CID 75375699) has the molecular formula C17H16N4O2S and a molecular weight of 340.41 g/mol. Its IUPAC name is N-(2-methyl-5,6,7,8-tetrahydroquinazolin-5-yl)-2-sulfanylidene-3H-1,3-benzoxazole-6-carboxamide.
| Compound Name | N-(2-methyl-5,6,7,8-tetrahydroquinazolin-5-yl)-2-sulfanylidene-3H-1,3-benzoxazole-6-carboxamide |
|---|---|
| PubChem CID | 75375699 |
| Molecular Formula | C17H16N4O2S |
| Molecular Weight | 340.41 g/mol |
| Exact Mass | 340.10 |
| IUPAC Name | N-(2-methyl-5,6,7,8-tetrahydroquinazolin-5-yl)-2-sulfanylidene-3H-1,3-benzoxazole-6-carboxamide |
| SMILES | Cc1ncc2c(n1)CCCC2NC(=O)c1ccc2[nH]c(=S)oc2c1 |
| InChI | InChI=1S/C17H16N4O2S/c1-9-18-8-11-12(19-9)3-2-4-13(11)20-16(22)10-5-6-14-15(7-10)23-17(24)21-14/h5-8,13H,2-4H2,1H3,(H,20,22)(H,21,24) |
| InChIKey | JZHBDRJQFMXGEY-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 83.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.41 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|