About N-[1-[1-(5-tert-butyl-1,3-oxazol-2-yl)ethyl]piperidin-4-yl]furan-3-carboxamide
N-[1-[1-(5-tert-butyl-1,3-oxazol-2-yl)ethyl]piperidin-4-yl]furan-3-carboxamide (PubChem CID 75376162) has the molecular formula C19H27N3O3
and a molecular weight of 345.44 g/mol. Its IUPAC name is N-[1-[1-(5-tert-butyl-1,3-oxazol-2-yl)ethyl]piperidin-4-yl]furan-3-carboxamide.
Molecular Properties
| Compound Name | N-[1-[1-(5-tert-butyl-1,3-oxazol-2-yl)ethyl]piperidin-4-yl]furan-3-carboxamide |
| PubChem CID | 75376162 |
| Molecular Formula | C19H27N3O3 |
| Molecular Weight | 345.44 g/mol |
| Exact Mass | 345.21 |
| IUPAC Name | N-[1-[1-(5-tert-butyl-1,3-oxazol-2-yl)ethyl]piperidin-4-yl]furan-3-carboxamide |
| SMILES | CC(c1ncc(C(C)(C)C)o1)N1CCC(NC(=O)c2ccoc2)CC1 |
| InChI | InChI=1S/C19H27N3O3/c1-13(18-20-11-16(25-18)19(2,3)4)22-8-5-15(6-9-22)21-17(23)14-7-10-24-12-14/h7,10-13,15H,5-6,8-9H2,1-4H3,(H,21,23) |
| InChIKey | ZCTORUFJTOPNKK-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 71.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 345.44 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-[1-[1-(5-tert-butyl-1,3-oxazol-2-yl)ethyl]piperidin-4-yl]furan-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[1-[1-(5-tert-butyl-1,3-oxazol-2-yl)ethyl]piperidin-4-yl]furan-3-carboxamide?
The IUPAC name of N-[1-[1-(5-tert-butyl-1,3-oxazol-2-yl)ethyl]piperidin-4-yl]furan-3-carboxamide (CID 75376162) is N-[1-[1-(5-tert-butyl-1,3-oxazol-2-yl)ethyl]piperidin-4-yl]furan-3-carboxamide.
What is the SMILES notation for N-[1-[1-(5-tert-butyl-1,3-oxazol-2-yl)ethyl]piperidin-4-yl]furan-3-carboxamide?
The canonical SMILES for N-[1-[1-(5-tert-butyl-1,3-oxazol-2-yl)ethyl]piperidin-4-yl]furan-3-carboxamide is CC(c1ncc(C(C)(C)C)o1)N1CCC(NC(=O)c2ccoc2)CC1.
What is the InChIKey of N-[1-[1-(5-tert-butyl-1,3-oxazol-2-yl)ethyl]piperidin-4-yl]furan-3-carboxamide?
The InChIKey is ZCTORUFJTOPNKK-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H27N3O3/c1-13(18-20-11-16(25-18)19(2,3)4)22-8-5-15(6-9-22)21-17(23)14-7-10-24-12-14/h7,10-13,15H,5-6,8-9H2,1-4H3,(H,21,23).
What are the key properties of N-[1-[1-(5-tert-butyl-1,3-oxazol-2-yl)ethyl]piperidin-4-yl]furan-3-carboxamide?
N-[1-[1-(5-tert-butyl-1,3-oxazol-2-yl)ethyl]piperidin-4-yl]furan-3-carboxamide has a molecular weight of 345.44 g/mol, XLogP of 3.52, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[1-[1-(5-tert-butyl-1,3-oxazol-2-yl)ethyl]piperidin-4-yl]furan-3-carboxamide is sourced from PubChem (CID 75376162), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).