About 2-[[1-(2,2,2-trifluoroethyl)imidazol-2-yl]methylsulfanyl]phenol
2-[[1-(2,2,2-trifluoroethyl)imidazol-2-yl]methylsulfanyl]phenol (PubChem CID 75376233) has the molecular formula C12H11F3N2OS
and a molecular weight of 288.29 g/mol. Its IUPAC name is 2-[[1-(2,2,2-trifluoroethyl)imidazol-2-yl]methylsulfanyl]phenol.
Molecular Properties
| Compound Name | 2-[[1-(2,2,2-trifluoroethyl)imidazol-2-yl]methylsulfanyl]phenol |
| PubChem CID | 75376233 |
| Molecular Formula | C12H11F3N2OS |
| Molecular Weight | 288.29 g/mol |
| Exact Mass | 288.05 |
| IUPAC Name | 2-[[1-(2,2,2-trifluoroethyl)imidazol-2-yl]methylsulfanyl]phenol |
| SMILES | Oc1ccccc1SCc1nccn1CC(F)(F)F |
| InChI | InChI=1S/C12H11F3N2OS/c13-12(14,15)8-17-6-5-16-11(17)7-19-10-4-2-1-3-9(10)18/h1-6,18H,7-8H2 |
| InChIKey | RURVTYGSYGBQKT-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.29 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[[1-(2,2,2-trifluoroethyl)imidazol-2-yl]methylsulfanyl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[1-(2,2,2-trifluoroethyl)imidazol-2-yl]methylsulfanyl]phenol?
The IUPAC name of 2-[[1-(2,2,2-trifluoroethyl)imidazol-2-yl]methylsulfanyl]phenol (CID 75376233) is 2-[[1-(2,2,2-trifluoroethyl)imidazol-2-yl]methylsulfanyl]phenol.
What is the SMILES notation for 2-[[1-(2,2,2-trifluoroethyl)imidazol-2-yl]methylsulfanyl]phenol?
The canonical SMILES for 2-[[1-(2,2,2-trifluoroethyl)imidazol-2-yl]methylsulfanyl]phenol is Oc1ccccc1SCc1nccn1CC(F)(F)F.
What is the InChIKey of 2-[[1-(2,2,2-trifluoroethyl)imidazol-2-yl]methylsulfanyl]phenol?
The InChIKey is RURVTYGSYGBQKT-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11F3N2OS/c13-12(14,15)8-17-6-5-16-11(17)7-19-10-4-2-1-3-9(10)18/h1-6,18H,7-8H2.
What are the key properties of 2-[[1-(2,2,2-trifluoroethyl)imidazol-2-yl]methylsulfanyl]phenol?
2-[[1-(2,2,2-trifluoroethyl)imidazol-2-yl]methylsulfanyl]phenol has a molecular weight of 288.29 g/mol, XLogP of 3.44, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[1-(2,2,2-trifluoroethyl)imidazol-2-yl]methylsulfanyl]phenol is sourced from PubChem (CID 75376233), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).