C18H28N4O2 — CID 75376318
N,2-dimethyl-3-[methyl-[[4-(3-methylpyrrolidin-1-yl)phenyl]carbamoyl]amino]propanamide (PubChem CID 75376318) has the molecular formula C18H28N4O2 and a molecular weight of 332.45 g/mol. Its IUPAC name is N,2-dimethyl-3-[methyl-[[4-(3-methylpyrrolidin-1-yl)phenyl]carbamoyl]amino]propanamide.
| Compound Name | N,2-dimethyl-3-[methyl-[[4-(3-methylpyrrolidin-1-yl)phenyl]carbamoyl]amino]propanamide |
|---|---|
| PubChem CID | 75376318 |
| Molecular Formula | C18H28N4O2 |
| Molecular Weight | 332.45 g/mol |
| Exact Mass | 332.22 |
| IUPAC Name | N,2-dimethyl-3-[methyl-[[4-(3-methylpyrrolidin-1-yl)phenyl]carbamoyl]amino]propanamide |
| SMILES | CNC(=O)C(C)CN(C)C(=O)Nc1ccc(N2CCC(C)C2)cc1 |
| InChI | InChI=1S/C18H28N4O2/c1-13-9-10-22(11-13)16-7-5-15(6-8-16)20-18(24)21(4)12-14(2)17(23)19-3/h5-8,13-14H,9-12H2,1-4H3,(H,19,23)(H,20,24) |
| InChIKey | LOPNVIHBMDWRQX-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.45 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|