C11H12N6O3 — CID 75376448
2-methyl-5-nitro-N-[1-(1H-1,2,4-triazol-5-yl)ethyl]pyridine-3-carboxamide (PubChem CID 75376448) has the molecular formula C11H12N6O3 and a molecular weight of 276.26 g/mol. Its IUPAC name is 2-methyl-5-nitro-N-[1-(1H-1,2,4-triazol-5-yl)ethyl]pyridine-3-carboxamide.
| Compound Name | 2-methyl-5-nitro-N-[1-(1H-1,2,4-triazol-5-yl)ethyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 75376448 |
| Molecular Formula | C11H12N6O3 |
| Molecular Weight | 276.26 g/mol |
| Exact Mass | 276.10 |
| IUPAC Name | 2-methyl-5-nitro-N-[1-(1H-1,2,4-triazol-5-yl)ethyl]pyridine-3-carboxamide |
| SMILES | Cc1ncc([N+](=O)[O-])cc1C(=O)NC(C)c1ncn[nH]1 |
| InChI | InChI=1S/C11H12N6O3/c1-6-9(3-8(4-12-6)17(19)20)11(18)15-7(2)10-13-5-14-16-10/h3-5,7H,1-2H3,(H,15,18)(H,13,14,16) |
| InChIKey | BVNHRJQEYMYOQI-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 126.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.26 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|