C22H27N3O5 — CID 7537646
[(2S)-1-(cyclohexylcarbamoylamino)-1-oxopropan-2-yl] (E)-2-cyano-3-(4-ethoxyphenyl)prop-2-enoate (PubChem CID 7537646) has the molecular formula C22H27N3O5 and a molecular weight of 413.47 g/mol. Its IUPAC name is [(2S)-1-(cyclohexylcarbamoylamino)-1-oxopropan-2-yl] (E)-2-cyano-3-(4-ethoxyphenyl)prop-2-enoate.
| Compound Name | [(2S)-1-(cyclohexylcarbamoylamino)-1-oxopropan-2-yl] (E)-2-cyano-3-(4-ethoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 7537646 |
| Molecular Formula | C22H27N3O5 |
| Molecular Weight | 413.47 g/mol |
| Exact Mass | 413.20 |
| IUPAC Name | [(2S)-1-(cyclohexylcarbamoylamino)-1-oxopropan-2-yl] (E)-2-cyano-3-(4-ethoxyphenyl)prop-2-enoate |
| SMILES | CCOc1ccc(/C=C(\C#N)C(=O)O[C@@H](C)C(=O)NC(=O)NC2CCCCC2)cc1 |
| InChI | InChI=1S/C22H27N3O5/c1-3-29-19-11-9-16(10-12-19)13-17(14-23)21(27)30-15(2)20(26)25-22(28)24-18-7-5-4-6-8-18/h9-13,15,18H,3-8H2,1-2H3,(H2,24,25,26,28)/b17-13+/t15-/m0/s1 |
| InChIKey | TZIVFZQZKKRAIN-XOAFGZPJSA-N |
| XLogP | 3.08 |
| TPSA | 117.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.47 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|