About N-[(1-ethylimidazol-2-yl)methyl]-N'-pyrimidin-2-ylpropane-1,3-diamine
N-[(1-ethylimidazol-2-yl)methyl]-N'-pyrimidin-2-ylpropane-1,3-diamine (PubChem CID 75377478) has the molecular formula C13H20N6
and a molecular weight of 260.34 g/mol. Its IUPAC name is N-[(1-ethylimidazol-2-yl)methyl]-N'-pyrimidin-2-ylpropane-1,3-diamine.
Molecular Properties
| Compound Name | N-[(1-ethylimidazol-2-yl)methyl]-N'-pyrimidin-2-ylpropane-1,3-diamine |
| PubChem CID | 75377478 |
| Molecular Formula | C13H20N6 |
| Molecular Weight | 260.34 g/mol |
| Exact Mass | 260.17 |
| IUPAC Name | N-[(1-ethylimidazol-2-yl)methyl]-N'-pyrimidin-2-ylpropane-1,3-diamine |
| SMILES | CCn1ccnc1CNCCCNc1ncccn1 |
| InChI | InChI=1S/C13H20N6/c1-2-19-10-9-15-12(19)11-14-5-3-6-16-13-17-7-4-8-18-13/h4,7-10,14H,2-3,5-6,11H2,1H3,(H,16,17,18) |
| InChIKey | ZAJIHHAFXJIDHM-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 67.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.34 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-[(1-ethylimidazol-2-yl)methyl]-N'-pyrimidin-2-ylpropane-1,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(1-ethylimidazol-2-yl)methyl]-N'-pyrimidin-2-ylpropane-1,3-diamine?
The IUPAC name of N-[(1-ethylimidazol-2-yl)methyl]-N'-pyrimidin-2-ylpropane-1,3-diamine (CID 75377478) is N-[(1-ethylimidazol-2-yl)methyl]-N'-pyrimidin-2-ylpropane-1,3-diamine.
What is the SMILES notation for N-[(1-ethylimidazol-2-yl)methyl]-N'-pyrimidin-2-ylpropane-1,3-diamine?
The canonical SMILES for N-[(1-ethylimidazol-2-yl)methyl]-N'-pyrimidin-2-ylpropane-1,3-diamine is CCn1ccnc1CNCCCNc1ncccn1.
What is the InChIKey of N-[(1-ethylimidazol-2-yl)methyl]-N'-pyrimidin-2-ylpropane-1,3-diamine?
The InChIKey is ZAJIHHAFXJIDHM-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20N6/c1-2-19-10-9-15-12(19)11-14-5-3-6-16-13-17-7-4-8-18-13/h4,7-10,14H,2-3,5-6,11H2,1H3,(H,16,17,18).
What are the key properties of N-[(1-ethylimidazol-2-yl)methyl]-N'-pyrimidin-2-ylpropane-1,3-diamine?
N-[(1-ethylimidazol-2-yl)methyl]-N'-pyrimidin-2-ylpropane-1,3-diamine has a molecular weight of 260.34 g/mol, XLogP of 1.28, 8 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(1-ethylimidazol-2-yl)methyl]-N'-pyrimidin-2-ylpropane-1,3-diamine is sourced from PubChem (CID 75377478), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).