C22H26N2O6 — CID 7537751
ethyl 1-[2-[(E)-2-cyano-3-(4-ethoxyphenyl)prop-2-enoyl]oxyacetyl]piperidine-4-carboxylate (PubChem CID 7537751) has the molecular formula C22H26N2O6 and a molecular weight of 414.46 g/mol. Its IUPAC name is ethyl 1-[2-[(E)-2-cyano-3-(4-ethoxyphenyl)prop-2-enoyl]oxyacetyl]piperidine-4-carboxylate.
| Compound Name | ethyl 1-[2-[(E)-2-cyano-3-(4-ethoxyphenyl)prop-2-enoyl]oxyacetyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 7537751 |
| Molecular Formula | C22H26N2O6 |
| Molecular Weight | 414.46 g/mol |
| Exact Mass | 414.18 |
| IUPAC Name | ethyl 1-[2-[(E)-2-cyano-3-(4-ethoxyphenyl)prop-2-enoyl]oxyacetyl]piperidine-4-carboxylate |
| SMILES | CCOC(=O)C1CCN(C(=O)COC(=O)/C(C#N)=C/c2ccc(OCC)cc2)CC1 |
| InChI | InChI=1S/C22H26N2O6/c1-3-28-19-7-5-16(6-8-19)13-18(14-23)22(27)30-15-20(25)24-11-9-17(10-12-24)21(26)29-4-2/h5-8,13,17H,3-4,9-12,15H2,1-2H3/b18-13+ |
| InChIKey | HGIFKRLHWMDBBR-QGOAFFKASA-N |
| XLogP | 2.34 |
| TPSA | 105.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.46 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|