C13H21F3N6O — CID 75377534
1-(2-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-8-yl)-3-[2-[methyl(2,2,2-trifluoroethyl)amino]ethyl]urea (PubChem CID 75377534) has the molecular formula C13H21F3N6O and a molecular weight of 334.35 g/mol. Its IUPAC name is 1-(2-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-8-yl)-3-[2-[methyl(2,2,2-trifluoroethyl)amino]ethyl]urea.
| Compound Name | 1-(2-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-8-yl)-3-[2-[methyl(2,2,2-trifluoroethyl)amino]ethyl]urea |
|---|---|
| PubChem CID | 75377534 |
| Molecular Formula | C13H21F3N6O |
| Molecular Weight | 334.35 g/mol |
| Exact Mass | 334.17 |
| IUPAC Name | 1-(2-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-8-yl)-3-[2-[methyl(2,2,2-trifluoroethyl)amino]ethyl]urea |
| SMILES | Cc1nc2n(n1)CCCC2NC(=O)NCCN(C)CC(F)(F)F |
| InChI | InChI=1S/C13H21F3N6O/c1-9-18-11-10(4-3-6-22(11)20-9)19-12(23)17-5-7-21(2)8-13(14,15)16/h10H,3-8H2,1-2H3,(H2,17,19,23) |
| InChIKey | PRDWQCCXYAVGGS-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 75.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.35 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |