C16H20FN5OS — CID 75377536
1-[2-(2-fluorophenyl)sulfanylethyl]-3-(2-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-8-yl)urea (PubChem CID 75377536) has the molecular formula C16H20FN5OS and a molecular weight of 349.44 g/mol. Its IUPAC name is 1-[2-(2-fluorophenyl)sulfanylethyl]-3-(2-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-8-yl)urea.
| Compound Name | 1-[2-(2-fluorophenyl)sulfanylethyl]-3-(2-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-8-yl)urea |
|---|---|
| PubChem CID | 75377536 |
| Molecular Formula | C16H20FN5OS |
| Molecular Weight | 349.44 g/mol |
| Exact Mass | 349.14 |
| IUPAC Name | 1-[2-(2-fluorophenyl)sulfanylethyl]-3-(2-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-8-yl)urea |
| SMILES | Cc1nc2n(n1)CCCC2NC(=O)NCCSc1ccccc1F |
| InChI | InChI=1S/C16H20FN5OS/c1-11-19-15-13(6-4-9-22(15)21-11)20-16(23)18-8-10-24-14-7-3-2-5-12(14)17/h2-3,5,7,13H,4,6,8-10H2,1H3,(H2,18,20,23) |
| InChIKey | AOXCQVDURMEBIH-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 71.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.44 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|