About 2-(4-cyclopropyl-1,3-thiazol-2-yl)-N-(1H-indazol-7-ylmethyl)ethanamine
2-(4-cyclopropyl-1,3-thiazol-2-yl)-N-(1H-indazol-7-ylmethyl)ethanamine (PubChem CID 75377665) has the molecular formula C16H18N4S
and a molecular weight of 298.41 g/mol. Its IUPAC name is 2-(4-cyclopropyl-1,3-thiazol-2-yl)-N-(1H-indazol-7-ylmethyl)ethanamine.
Molecular Properties
| Compound Name | 2-(4-cyclopropyl-1,3-thiazol-2-yl)-N-(1H-indazol-7-ylmethyl)ethanamine |
| PubChem CID | 75377665 |
| Molecular Formula | C16H18N4S |
| Molecular Weight | 298.41 g/mol |
| Exact Mass | 298.13 |
| IUPAC Name | 2-(4-cyclopropyl-1,3-thiazol-2-yl)-N-(1H-indazol-7-ylmethyl)ethanamine |
| SMILES | c1cc(CNCCc2nc(C3CC3)cs2)c2[nH]ncc2c1 |
| InChI | InChI=1S/C16H18N4S/c1-2-12(16-13(3-1)9-18-20-16)8-17-7-6-15-19-14(10-21-15)11-4-5-11/h1-3,9-11,17H,4-8H2,(H,18,20) |
| InChIKey | XLYDNDGVLPTRMG-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.41 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-(4-cyclopropyl-1,3-thiazol-2-yl)-N-(1H-indazol-7-ylmethyl)ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-cyclopropyl-1,3-thiazol-2-yl)-N-(1H-indazol-7-ylmethyl)ethanamine?
The IUPAC name of 2-(4-cyclopropyl-1,3-thiazol-2-yl)-N-(1H-indazol-7-ylmethyl)ethanamine (CID 75377665) is 2-(4-cyclopropyl-1,3-thiazol-2-yl)-N-(1H-indazol-7-ylmethyl)ethanamine.
What is the SMILES notation for 2-(4-cyclopropyl-1,3-thiazol-2-yl)-N-(1H-indazol-7-ylmethyl)ethanamine?
The canonical SMILES for 2-(4-cyclopropyl-1,3-thiazol-2-yl)-N-(1H-indazol-7-ylmethyl)ethanamine is c1cc(CNCCc2nc(C3CC3)cs2)c2[nH]ncc2c1.
What is the InChIKey of 2-(4-cyclopropyl-1,3-thiazol-2-yl)-N-(1H-indazol-7-ylmethyl)ethanamine?
The InChIKey is XLYDNDGVLPTRMG-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H18N4S/c1-2-12(16-13(3-1)9-18-20-16)8-17-7-6-15-19-14(10-21-15)11-4-5-11/h1-3,9-11,17H,4-8H2,(H,18,20).
What are the key properties of 2-(4-cyclopropyl-1,3-thiazol-2-yl)-N-(1H-indazol-7-ylmethyl)ethanamine?
2-(4-cyclopropyl-1,3-thiazol-2-yl)-N-(1H-indazol-7-ylmethyl)ethanamine has a molecular weight of 298.41 g/mol, XLogP of 3.23, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-cyclopropyl-1,3-thiazol-2-yl)-N-(1H-indazol-7-ylmethyl)ethanamine is sourced from PubChem (CID 75377665), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).