C18H14F3N3O — CID 75378275
N-[(5-cyclopropyl-1,3,4-oxadiazol-2-yl)methyl]-2-(3,4,5-trifluorophenyl)aniline (PubChem CID 75378275) has the molecular formula C18H14F3N3O and a molecular weight of 345.32 g/mol. Its IUPAC name is N-[(5-cyclopropyl-1,3,4-oxadiazol-2-yl)methyl]-2-(3,4,5-trifluorophenyl)aniline.
| Compound Name | N-[(5-cyclopropyl-1,3,4-oxadiazol-2-yl)methyl]-2-(3,4,5-trifluorophenyl)aniline |
|---|---|
| PubChem CID | 75378275 |
| Molecular Formula | C18H14F3N3O |
| Molecular Weight | 345.32 g/mol |
| Exact Mass | 345.11 |
| IUPAC Name | N-[(5-cyclopropyl-1,3,4-oxadiazol-2-yl)methyl]-2-(3,4,5-trifluorophenyl)aniline |
| SMILES | Fc1cc(-c2ccccc2NCc2nnc(C3CC3)o2)cc(F)c1F |
| InChI | InChI=1S/C18H14F3N3O/c19-13-7-11(8-14(20)17(13)21)12-3-1-2-4-15(12)22-9-16-23-24-18(25-16)10-5-6-10/h1-4,7-8,10,22H,5-6,9H2 |
| InChIKey | YLCKRZVBLTXNKS-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 50.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.32 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|