About 1-benzyl-1,3-diazinane
1-benzyl-1,3-diazinane (PubChem CID 753786) has the molecular formula C11H16N2
and a molecular weight of 176.26 g/mol. Its IUPAC name is 1-benzyl-1,3-diazinane.
Molecular Properties
| Compound Name | 1-benzyl-1,3-diazinane |
| PubChem CID | 753786 |
| Molecular Formula | C11H16N2 |
| Molecular Weight | 176.26 g/mol |
| Exact Mass | 176.13 |
| IUPAC Name | 1-benzyl-1,3-diazinane |
| SMILES | c1ccc(CN2CCCNC2)cc1 |
| InChI | InChI=1S/C11H16N2/c1-2-5-11(6-3-1)9-13-8-4-7-12-10-13/h1-3,5-6,12H,4,7-10H2 |
| InChIKey | KOSJUMIQLLFOIG-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.26 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-benzyl-1,3-diazinane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-benzyl-1,3-diazinane?
The IUPAC name of 1-benzyl-1,3-diazinane (CID 753786) is 1-benzyl-1,3-diazinane.
What is the SMILES notation for 1-benzyl-1,3-diazinane?
The canonical SMILES for 1-benzyl-1,3-diazinane is c1ccc(CN2CCCNC2)cc1.
What is the InChIKey of 1-benzyl-1,3-diazinane?
The InChIKey is KOSJUMIQLLFOIG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16N2/c1-2-5-11(6-3-1)9-13-8-4-7-12-10-13/h1-3,5-6,12H,4,7-10H2.
What are the key properties of 1-benzyl-1,3-diazinane?
1-benzyl-1,3-diazinane has a molecular weight of 176.26 g/mol, XLogP of 1.44, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-benzyl-1,3-diazinane is sourced from PubChem (CID 753786), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).