C18H24N2O2 — CID 7537881
2-[(1R,4aS,8aS)-4a-hydroxy-1-(4-methoxyphenyl)-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl]acetonitrile (PubChem CID 7537881) has the molecular formula C18H24N2O2 and a molecular weight of 300.40 g/mol. Its IUPAC name is 2-[(1R,4aS,8aS)-4a-hydroxy-1-(4-methoxyphenyl)-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl]acetonitrile.
| Compound Name | 2-[(1R,4aS,8aS)-4a-hydroxy-1-(4-methoxyphenyl)-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl]acetonitrile |
|---|---|
| PubChem CID | 7537881 |
| Molecular Formula | C18H24N2O2 |
| Molecular Weight | 300.40 g/mol |
| Exact Mass | 300.18 |
| IUPAC Name | 2-[(1R,4aS,8aS)-4a-hydroxy-1-(4-methoxyphenyl)-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl]acetonitrile |
| SMILES | COc1ccc([C@H]2[C@@H]3CCCC[C@]3(O)CCN2CC#N)cc1 |
| InChI | InChI=1S/C18H24N2O2/c1-22-15-7-5-14(6-8-15)17-16-4-2-3-9-18(16,21)10-12-20(17)13-11-19/h5-8,16-17,21H,2-4,9-10,12-13H2,1H3/t16-,17-,18-/m0/s1 |
| InChIKey | FMBWXWJAWGGINB-BZSNNMDCSA-N |
| XLogP | 2.89 |
| TPSA | 56.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.40 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|