C19H28N2O2 — CID 75379081
3-(2,2-dimethylpropylamino)-N-[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]-2-methylbenzamide (PubChem CID 75379081) has the molecular formula C19H28N2O2 and a molecular weight of 316.44 g/mol. Its IUPAC name is 3-(2,2-dimethylpropylamino)-N-[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]-2-methylbenzamide.
| Compound Name | 3-(2,2-dimethylpropylamino)-N-[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]-2-methylbenzamide |
|---|---|
| PubChem CID | 75379081 |
| Molecular Formula | C19H28N2O2 |
| Molecular Weight | 316.44 g/mol |
| Exact Mass | 316.22 |
| IUPAC Name | 3-(2,2-dimethylpropylamino)-N-[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]-2-methylbenzamide |
| SMILES | Cc1c(NCC(C)(C)C)cccc1C(=O)N[C@@H]1C=C[C@H](CO)C1 |
| InChI | InChI=1S/C19H28N2O2/c1-13-16(6-5-7-17(13)20-12-19(2,3)4)18(23)21-15-9-8-14(10-15)11-22/h5-9,14-15,20,22H,10-12H2,1-4H3,(H,21,23)/t14-,15+/m0/s1 |
| InChIKey | TZRIISIMWPTTKS-LSDHHAIUSA-N |
| XLogP | 3.12 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.44 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|