About N-[2-[2-(2-methyl-1,3-thiazol-4-yl)ethylsulfamoyl]ethyl]benzenesulfonamide
N-[2-[2-(2-methyl-1,3-thiazol-4-yl)ethylsulfamoyl]ethyl]benzenesulfonamide (PubChem CID 75379430) has the molecular formula C14H19N3O4S3
and a molecular weight of 389.52 g/mol. Its IUPAC name is N-[2-[2-(2-methyl-1,3-thiazol-4-yl)ethylsulfamoyl]ethyl]benzenesulfonamide.
Molecular Properties
| Compound Name | N-[2-[2-(2-methyl-1,3-thiazol-4-yl)ethylsulfamoyl]ethyl]benzenesulfonamide |
| PubChem CID | 75379430 |
| Molecular Formula | C14H19N3O4S3 |
| Molecular Weight | 389.52 g/mol |
| Exact Mass | 389.05 |
| IUPAC Name | N-[2-[2-(2-methyl-1,3-thiazol-4-yl)ethylsulfamoyl]ethyl]benzenesulfonamide |
| SMILES | Cc1nc(CCNS(=O)(=O)CCNS(=O)(=O)c2ccccc2)cs1 |
| InChI | InChI=1S/C14H19N3O4S3/c1-12-17-13(11-22-12)7-8-15-23(18,19)10-9-16-24(20,21)14-5-3-2-4-6-14/h2-6,11,15-16H,7-10H2,1H3 |
| InChIKey | HLGGTPKDAGGLNL-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 105.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 389.52 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-[2-[2-(2-methyl-1,3-thiazol-4-yl)ethylsulfamoyl]ethyl]benzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-[2-(2-methyl-1,3-thiazol-4-yl)ethylsulfamoyl]ethyl]benzenesulfonamide?
The IUPAC name of N-[2-[2-(2-methyl-1,3-thiazol-4-yl)ethylsulfamoyl]ethyl]benzenesulfonamide (CID 75379430) is N-[2-[2-(2-methyl-1,3-thiazol-4-yl)ethylsulfamoyl]ethyl]benzenesulfonamide.
What is the SMILES notation for N-[2-[2-(2-methyl-1,3-thiazol-4-yl)ethylsulfamoyl]ethyl]benzenesulfonamide?
The canonical SMILES for N-[2-[2-(2-methyl-1,3-thiazol-4-yl)ethylsulfamoyl]ethyl]benzenesulfonamide is Cc1nc(CCNS(=O)(=O)CCNS(=O)(=O)c2ccccc2)cs1.
What is the InChIKey of N-[2-[2-(2-methyl-1,3-thiazol-4-yl)ethylsulfamoyl]ethyl]benzenesulfonamide?
The InChIKey is HLGGTPKDAGGLNL-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19N3O4S3/c1-12-17-13(11-22-12)7-8-15-23(18,19)10-9-16-24(20,21)14-5-3-2-4-6-14/h2-6,11,15-16H,7-10H2,1H3.
What are the key properties of N-[2-[2-(2-methyl-1,3-thiazol-4-yl)ethylsulfamoyl]ethyl]benzenesulfonamide?
N-[2-[2-(2-methyl-1,3-thiazol-4-yl)ethylsulfamoyl]ethyl]benzenesulfonamide has a molecular weight of 389.52 g/mol, XLogP of 0.89, 9 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-[2-(2-methyl-1,3-thiazol-4-yl)ethylsulfamoyl]ethyl]benzenesulfonamide is sourced from PubChem (CID 75379430), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).