About N-[5-(3,5-dimethylphenyl)-1H-pyrazol-3-yl]-4-methyl-6-oxo-1H-pyridine-3-carboxamide
N-[5-(3,5-dimethylphenyl)-1H-pyrazol-3-yl]-4-methyl-6-oxo-1H-pyridine-3-carboxamide (PubChem CID 75379837) has the molecular formula C18H18N4O2
and a molecular weight of 322.37 g/mol. Its IUPAC name is N-[5-(3,5-dimethylphenyl)-1H-pyrazol-3-yl]-4-methyl-6-oxo-1H-pyridine-3-carboxamide.
Molecular Properties
| Compound Name | N-[5-(3,5-dimethylphenyl)-1H-pyrazol-3-yl]-4-methyl-6-oxo-1H-pyridine-3-carboxamide |
| PubChem CID | 75379837 |
| Molecular Formula | C18H18N4O2 |
| Molecular Weight | 322.37 g/mol |
| Exact Mass | 322.14 |
| IUPAC Name | N-[5-(3,5-dimethylphenyl)-1H-pyrazol-3-yl]-4-methyl-6-oxo-1H-pyridine-3-carboxamide |
| SMILES | Cc1cc(C)cc(-c2cc(NC(=O)c3c[nH]c(=O)cc3C)n[nH]2)c1 |
| InChI | InChI=1S/C18H18N4O2/c1-10-4-11(2)6-13(5-10)15-8-16(22-21-15)20-18(24)14-9-19-17(23)7-12(14)3/h4-9H,1-3H3,(H,19,23)(H2,20,21,22,24) |
| InChIKey | ZKUMBCIOHHIVOD-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 90.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 322.37 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[5-(3,5-dimethylphenyl)-1H-pyrazol-3-yl]-4-methyl-6-oxo-1H-pyridine-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[5-(3,5-dimethylphenyl)-1H-pyrazol-3-yl]-4-methyl-6-oxo-1H-pyridine-3-carboxamide?
The IUPAC name of N-[5-(3,5-dimethylphenyl)-1H-pyrazol-3-yl]-4-methyl-6-oxo-1H-pyridine-3-carboxamide (CID 75379837) is N-[5-(3,5-dimethylphenyl)-1H-pyrazol-3-yl]-4-methyl-6-oxo-1H-pyridine-3-carboxamide.
What is the SMILES notation for N-[5-(3,5-dimethylphenyl)-1H-pyrazol-3-yl]-4-methyl-6-oxo-1H-pyridine-3-carboxamide?
The canonical SMILES for N-[5-(3,5-dimethylphenyl)-1H-pyrazol-3-yl]-4-methyl-6-oxo-1H-pyridine-3-carboxamide is Cc1cc(C)cc(-c2cc(NC(=O)c3c[nH]c(=O)cc3C)n[nH]2)c1.
What is the InChIKey of N-[5-(3,5-dimethylphenyl)-1H-pyrazol-3-yl]-4-methyl-6-oxo-1H-pyridine-3-carboxamide?
The InChIKey is ZKUMBCIOHHIVOD-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H18N4O2/c1-10-4-11(2)6-13(5-10)15-8-16(22-21-15)20-18(24)14-9-19-17(23)7-12(14)3/h4-9H,1-3H3,(H,19,23)(H2,20,21,22,24).
What are the key properties of N-[5-(3,5-dimethylphenyl)-1H-pyrazol-3-yl]-4-methyl-6-oxo-1H-pyridine-3-carboxamide?
N-[5-(3,5-dimethylphenyl)-1H-pyrazol-3-yl]-4-methyl-6-oxo-1H-pyridine-3-carboxamide has a molecular weight of 322.37 g/mol, XLogP of 2.94, 3 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[5-(3,5-dimethylphenyl)-1H-pyrazol-3-yl]-4-methyl-6-oxo-1H-pyridine-3-carboxamide is sourced from PubChem (CID 75379837), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).