About [(2R)-1-(5-chloro-3,4-dihydro-1H-isoquinolin-2-yl)-1-oxopentan-2-yl]urea
[(2R)-1-(5-chloro-3,4-dihydro-1H-isoquinolin-2-yl)-1-oxopentan-2-yl]urea (PubChem CID 75379925) has the molecular formula C15H20ClN3O2
and a molecular weight of 309.80 g/mol. Its IUPAC name is [(2R)-1-(5-chloro-3,4-dihydro-1H-isoquinolin-2-yl)-1-oxopentan-2-yl]urea.
Molecular Properties
| Compound Name | [(2R)-1-(5-chloro-3,4-dihydro-1H-isoquinolin-2-yl)-1-oxopentan-2-yl]urea |
| PubChem CID | 75379925 |
| Molecular Formula | C15H20ClN3O2 |
| Molecular Weight | 309.80 g/mol |
| Exact Mass | 309.12 |
| IUPAC Name | [(2R)-1-(5-chloro-3,4-dihydro-1H-isoquinolin-2-yl)-1-oxopentan-2-yl]urea |
| SMILES | CCC[C@@H](NC(N)=O)C(=O)N1CCc2c(Cl)cccc2C1 |
| InChI | InChI=1S/C15H20ClN3O2/c1-2-4-13(18-15(17)21)14(20)19-8-7-11-10(9-19)5-3-6-12(11)16/h3,5-6,13H,2,4,7-9H2,1H3,(H3,17,18,21)/t13-/m1/s1 |
| InChIKey | YPZVQZXHJCOHIN-CYBMUJFWSA-N |
| XLogP | 2.06 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 309.80 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze [(2R)-1-(5-chloro-3,4-dihydro-1H-isoquinolin-2-yl)-1-oxopentan-2-yl]urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2R)-1-(5-chloro-3,4-dihydro-1H-isoquinolin-2-yl)-1-oxopentan-2-yl]urea?
The IUPAC name of [(2R)-1-(5-chloro-3,4-dihydro-1H-isoquinolin-2-yl)-1-oxopentan-2-yl]urea (CID 75379925) is [(2R)-1-(5-chloro-3,4-dihydro-1H-isoquinolin-2-yl)-1-oxopentan-2-yl]urea.
What is the SMILES notation for [(2R)-1-(5-chloro-3,4-dihydro-1H-isoquinolin-2-yl)-1-oxopentan-2-yl]urea?
The canonical SMILES for [(2R)-1-(5-chloro-3,4-dihydro-1H-isoquinolin-2-yl)-1-oxopentan-2-yl]urea is CCC[C@@H](NC(N)=O)C(=O)N1CCc2c(Cl)cccc2C1.
What is the InChIKey of [(2R)-1-(5-chloro-3,4-dihydro-1H-isoquinolin-2-yl)-1-oxopentan-2-yl]urea?
The InChIKey is YPZVQZXHJCOHIN-CYBMUJFWSA-N. The full InChI is InChI=1S/C15H20ClN3O2/c1-2-4-13(18-15(17)21)14(20)19-8-7-11-10(9-19)5-3-6-12(11)16/h3,5-6,13H,2,4,7-9H2,1H3,(H3,17,18,21)/t13-/m1/s1.
What are the key properties of [(2R)-1-(5-chloro-3,4-dihydro-1H-isoquinolin-2-yl)-1-oxopentan-2-yl]urea?
[(2R)-1-(5-chloro-3,4-dihydro-1H-isoquinolin-2-yl)-1-oxopentan-2-yl]urea has a molecular weight of 309.80 g/mol, XLogP of 2.06, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(2R)-1-(5-chloro-3,4-dihydro-1H-isoquinolin-2-yl)-1-oxopentan-2-yl]urea is sourced from PubChem (CID 75379925), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).