About N-methyl-N-[2-(1H-1,2,4-triazol-5-ylsulfanyl)ethyl]aniline
N-methyl-N-[2-(1H-1,2,4-triazol-5-ylsulfanyl)ethyl]aniline (PubChem CID 75380454) has the molecular formula C11H14N4S
and a molecular weight of 234.33 g/mol. Its IUPAC name is N-methyl-N-[2-(1H-1,2,4-triazol-5-ylsulfanyl)ethyl]aniline.
Molecular Properties
| Compound Name | N-methyl-N-[2-(1H-1,2,4-triazol-5-ylsulfanyl)ethyl]aniline |
| PubChem CID | 75380454 |
| Molecular Formula | C11H14N4S |
| Molecular Weight | 234.33 g/mol |
| Exact Mass | 234.09 |
| IUPAC Name | N-methyl-N-[2-(1H-1,2,4-triazol-5-ylsulfanyl)ethyl]aniline |
| SMILES | CN(CCSc1ncn[nH]1)c1ccccc1 |
| InChI | InChI=1S/C11H14N4S/c1-15(10-5-3-2-4-6-10)7-8-16-11-12-9-13-14-11/h2-6,9H,7-8H2,1H3,(H,12,13,14) |
| InChIKey | SRBDOIWGAUHQHP-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.33 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-methyl-N-[2-(1H-1,2,4-triazol-5-ylsulfanyl)ethyl]aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-N-[2-(1H-1,2,4-triazol-5-ylsulfanyl)ethyl]aniline?
The IUPAC name of N-methyl-N-[2-(1H-1,2,4-triazol-5-ylsulfanyl)ethyl]aniline (CID 75380454) is N-methyl-N-[2-(1H-1,2,4-triazol-5-ylsulfanyl)ethyl]aniline.
What is the SMILES notation for N-methyl-N-[2-(1H-1,2,4-triazol-5-ylsulfanyl)ethyl]aniline?
The canonical SMILES for N-methyl-N-[2-(1H-1,2,4-triazol-5-ylsulfanyl)ethyl]aniline is CN(CCSc1ncn[nH]1)c1ccccc1.
What is the InChIKey of N-methyl-N-[2-(1H-1,2,4-triazol-5-ylsulfanyl)ethyl]aniline?
The InChIKey is SRBDOIWGAUHQHP-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14N4S/c1-15(10-5-3-2-4-6-10)7-8-16-11-12-9-13-14-11/h2-6,9H,7-8H2,1H3,(H,12,13,14).
What are the key properties of N-methyl-N-[2-(1H-1,2,4-triazol-5-ylsulfanyl)ethyl]aniline?
N-methyl-N-[2-(1H-1,2,4-triazol-5-ylsulfanyl)ethyl]aniline has a molecular weight of 234.33 g/mol, XLogP of 2.03, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-N-[2-(1H-1,2,4-triazol-5-ylsulfanyl)ethyl]aniline is sourced from PubChem (CID 75380454), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).