About [4-[(5-ethyl-1,3-oxazol-2-yl)methylamino]-3-methylphenyl]-(3-methylpiperidin-1-yl)methanone
[4-[(5-ethyl-1,3-oxazol-2-yl)methylamino]-3-methylphenyl]-(3-methylpiperidin-1-yl)methanone (PubChem CID 75380550) has the molecular formula C20H27N3O2
and a molecular weight of 341.46 g/mol. Its IUPAC name is [4-[(5-ethyl-1,3-oxazol-2-yl)methylamino]-3-methylphenyl]-(3-methylpiperidin-1-yl)methanone.
Molecular Properties
| Compound Name | [4-[(5-ethyl-1,3-oxazol-2-yl)methylamino]-3-methylphenyl]-(3-methylpiperidin-1-yl)methanone |
| PubChem CID | 75380550 |
| Molecular Formula | C20H27N3O2 |
| Molecular Weight | 341.46 g/mol |
| Exact Mass | 341.21 |
| IUPAC Name | [4-[(5-ethyl-1,3-oxazol-2-yl)methylamino]-3-methylphenyl]-(3-methylpiperidin-1-yl)methanone |
| SMILES | CCc1cnc(CNc2ccc(C(=O)N3CCCC(C)C3)cc2C)o1 |
| InChI | InChI=1S/C20H27N3O2/c1-4-17-11-22-19(25-17)12-21-18-8-7-16(10-15(18)3)20(24)23-9-5-6-14(2)13-23/h7-8,10-11,14,21H,4-6,9,12-13H2,1-3H3 |
| InChIKey | PDSIJIOAOJIYMC-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 58.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 341.46 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [4-[(5-ethyl-1,3-oxazol-2-yl)methylamino]-3-methylphenyl]-(3-methylpiperidin-1-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[(5-ethyl-1,3-oxazol-2-yl)methylamino]-3-methylphenyl]-(3-methylpiperidin-1-yl)methanone?
The IUPAC name of [4-[(5-ethyl-1,3-oxazol-2-yl)methylamino]-3-methylphenyl]-(3-methylpiperidin-1-yl)methanone (CID 75380550) is [4-[(5-ethyl-1,3-oxazol-2-yl)methylamino]-3-methylphenyl]-(3-methylpiperidin-1-yl)methanone.
What is the SMILES notation for [4-[(5-ethyl-1,3-oxazol-2-yl)methylamino]-3-methylphenyl]-(3-methylpiperidin-1-yl)methanone?
The canonical SMILES for [4-[(5-ethyl-1,3-oxazol-2-yl)methylamino]-3-methylphenyl]-(3-methylpiperidin-1-yl)methanone is CCc1cnc(CNc2ccc(C(=O)N3CCCC(C)C3)cc2C)o1.
What is the InChIKey of [4-[(5-ethyl-1,3-oxazol-2-yl)methylamino]-3-methylphenyl]-(3-methylpiperidin-1-yl)methanone?
The InChIKey is PDSIJIOAOJIYMC-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H27N3O2/c1-4-17-11-22-19(25-17)12-21-18-8-7-16(10-15(18)3)20(24)23-9-5-6-14(2)13-23/h7-8,10-11,14,21H,4-6,9,12-13H2,1-3H3.
What are the key properties of [4-[(5-ethyl-1,3-oxazol-2-yl)methylamino]-3-methylphenyl]-(3-methylpiperidin-1-yl)methanone?
[4-[(5-ethyl-1,3-oxazol-2-yl)methylamino]-3-methylphenyl]-(3-methylpiperidin-1-yl)methanone has a molecular weight of 341.46 g/mol, XLogP of 4.03, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[(5-ethyl-1,3-oxazol-2-yl)methylamino]-3-methylphenyl]-(3-methylpiperidin-1-yl)methanone is sourced from PubChem (CID 75380550), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).