C16H15N5O2 — CID 75380583
3-nitro-2-(1,2,3,4-tetrahydroquinolin-2-ylmethylamino)pyridine-4-carbonitrile (PubChem CID 75380583) has the molecular formula C16H15N5O2 and a molecular weight of 309.33 g/mol. Its IUPAC name is 3-nitro-2-(1,2,3,4-tetrahydroquinolin-2-ylmethylamino)pyridine-4-carbonitrile.
| Compound Name | 3-nitro-2-(1,2,3,4-tetrahydroquinolin-2-ylmethylamino)pyridine-4-carbonitrile |
|---|---|
| PubChem CID | 75380583 |
| Molecular Formula | C16H15N5O2 |
| Molecular Weight | 309.33 g/mol |
| Exact Mass | 309.12 |
| IUPAC Name | 3-nitro-2-(1,2,3,4-tetrahydroquinolin-2-ylmethylamino)pyridine-4-carbonitrile |
| SMILES | N#Cc1ccnc(NCC2CCc3ccccc3N2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C16H15N5O2/c17-9-12-7-8-18-16(15(12)21(22)23)19-10-13-6-5-11-3-1-2-4-14(11)20-13/h1-4,7-8,13,20H,5-6,10H2,(H,18,19) |
| InChIKey | XRYDTPQHNDVIKC-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 103.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.33 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|