About 3-[2-[(2-cyclobutyl-1,3-thiazol-5-yl)methylamino]ethyl]benzamide
3-[2-[(2-cyclobutyl-1,3-thiazol-5-yl)methylamino]ethyl]benzamide (PubChem CID 75380790) has the molecular formula C17H21N3OS
and a molecular weight of 315.44 g/mol. Its IUPAC name is 3-[2-[(2-cyclobutyl-1,3-thiazol-5-yl)methylamino]ethyl]benzamide.
Molecular Properties
| Compound Name | 3-[2-[(2-cyclobutyl-1,3-thiazol-5-yl)methylamino]ethyl]benzamide |
| PubChem CID | 75380790 |
| Molecular Formula | C17H21N3OS |
| Molecular Weight | 315.44 g/mol |
| Exact Mass | 315.14 |
| IUPAC Name | 3-[2-[(2-cyclobutyl-1,3-thiazol-5-yl)methylamino]ethyl]benzamide |
| SMILES | NC(=O)c1cccc(CCNCc2cnc(C3CCC3)s2)c1 |
| InChI | InChI=1S/C17H21N3OS/c18-16(21)14-6-1-3-12(9-14)7-8-19-10-15-11-20-17(22-15)13-4-2-5-13/h1,3,6,9,11,13,19H,2,4-5,7-8,10H2,(H2,18,21) |
| InChIKey | PCXCEZPMFLAPGP-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.44 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-[2-[(2-cyclobutyl-1,3-thiazol-5-yl)methylamino]ethyl]benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[2-[(2-cyclobutyl-1,3-thiazol-5-yl)methylamino]ethyl]benzamide?
The IUPAC name of 3-[2-[(2-cyclobutyl-1,3-thiazol-5-yl)methylamino]ethyl]benzamide (CID 75380790) is 3-[2-[(2-cyclobutyl-1,3-thiazol-5-yl)methylamino]ethyl]benzamide.
What is the SMILES notation for 3-[2-[(2-cyclobutyl-1,3-thiazol-5-yl)methylamino]ethyl]benzamide?
The canonical SMILES for 3-[2-[(2-cyclobutyl-1,3-thiazol-5-yl)methylamino]ethyl]benzamide is NC(=O)c1cccc(CCNCc2cnc(C3CCC3)s2)c1.
What is the InChIKey of 3-[2-[(2-cyclobutyl-1,3-thiazol-5-yl)methylamino]ethyl]benzamide?
The InChIKey is PCXCEZPMFLAPGP-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H21N3OS/c18-16(21)14-6-1-3-12(9-14)7-8-19-10-15-11-20-17(22-15)13-4-2-5-13/h1,3,6,9,11,13,19H,2,4-5,7-8,10H2,(H2,18,21).
What are the key properties of 3-[2-[(2-cyclobutyl-1,3-thiazol-5-yl)methylamino]ethyl]benzamide?
3-[2-[(2-cyclobutyl-1,3-thiazol-5-yl)methylamino]ethyl]benzamide has a molecular weight of 315.44 g/mol, XLogP of 2.84, 7 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2-[(2-cyclobutyl-1,3-thiazol-5-yl)methylamino]ethyl]benzamide is sourced from PubChem (CID 75380790), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).