About 3-[(2-cyclobutyl-1,3-thiazol-5-yl)methylamino]-2-phenylpropan-1-ol
3-[(2-cyclobutyl-1,3-thiazol-5-yl)methylamino]-2-phenylpropan-1-ol (PubChem CID 75380822) has the molecular formula C17H22N2OS
and a molecular weight of 302.44 g/mol. Its IUPAC name is 3-[(2-cyclobutyl-1,3-thiazol-5-yl)methylamino]-2-phenylpropan-1-ol.
Molecular Properties
| Compound Name | 3-[(2-cyclobutyl-1,3-thiazol-5-yl)methylamino]-2-phenylpropan-1-ol |
| PubChem CID | 75380822 |
| Molecular Formula | C17H22N2OS |
| Molecular Weight | 302.44 g/mol |
| Exact Mass | 302.15 |
| IUPAC Name | 3-[(2-cyclobutyl-1,3-thiazol-5-yl)methylamino]-2-phenylpropan-1-ol |
| SMILES | OCC(CNCc1cnc(C2CCC2)s1)c1ccccc1 |
| InChI | InChI=1S/C17H22N2OS/c20-12-15(13-5-2-1-3-6-13)9-18-10-16-11-19-17(21-16)14-7-4-8-14/h1-3,5-6,11,14-15,18,20H,4,7-10,12H2 |
| InChIKey | SZDFAFHXBVQGEQ-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.44 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-[(2-cyclobutyl-1,3-thiazol-5-yl)methylamino]-2-phenylpropan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(2-cyclobutyl-1,3-thiazol-5-yl)methylamino]-2-phenylpropan-1-ol?
The IUPAC name of 3-[(2-cyclobutyl-1,3-thiazol-5-yl)methylamino]-2-phenylpropan-1-ol (CID 75380822) is 3-[(2-cyclobutyl-1,3-thiazol-5-yl)methylamino]-2-phenylpropan-1-ol.
What is the SMILES notation for 3-[(2-cyclobutyl-1,3-thiazol-5-yl)methylamino]-2-phenylpropan-1-ol?
The canonical SMILES for 3-[(2-cyclobutyl-1,3-thiazol-5-yl)methylamino]-2-phenylpropan-1-ol is OCC(CNCc1cnc(C2CCC2)s1)c1ccccc1.
What is the InChIKey of 3-[(2-cyclobutyl-1,3-thiazol-5-yl)methylamino]-2-phenylpropan-1-ol?
The InChIKey is SZDFAFHXBVQGEQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H22N2OS/c20-12-15(13-5-2-1-3-6-13)9-18-10-16-11-19-17(21-16)14-7-4-8-14/h1-3,5-6,11,14-15,18,20H,4,7-10,12H2.
What are the key properties of 3-[(2-cyclobutyl-1,3-thiazol-5-yl)methylamino]-2-phenylpropan-1-ol?
3-[(2-cyclobutyl-1,3-thiazol-5-yl)methylamino]-2-phenylpropan-1-ol has a molecular weight of 302.44 g/mol, XLogP of 3.28, 7 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(2-cyclobutyl-1,3-thiazol-5-yl)methylamino]-2-phenylpropan-1-ol is sourced from PubChem (CID 75380822), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).