C14H19NO4 — CID 75381047
(1-acetylpyrrolidin-3-yl) 5-ethyl-4-methylfuran-2-carboxylate (PubChem CID 75381047) has the molecular formula C14H19NO4 and a molecular weight of 265.31 g/mol. Its IUPAC name is (1-acetylpyrrolidin-3-yl) 5-ethyl-4-methylfuran-2-carboxylate.
| Compound Name | (1-acetylpyrrolidin-3-yl) 5-ethyl-4-methylfuran-2-carboxylate |
|---|---|
| PubChem CID | 75381047 |
| Molecular Formula | C14H19NO4 |
| Molecular Weight | 265.31 g/mol |
| Exact Mass | 265.13 |
| IUPAC Name | (1-acetylpyrrolidin-3-yl) 5-ethyl-4-methylfuran-2-carboxylate |
| SMILES | CCc1oc(C(=O)OC2CCN(C(C)=O)C2)cc1C |
| InChI | InChI=1S/C14H19NO4/c1-4-12-9(2)7-13(19-12)14(17)18-11-5-6-15(8-11)10(3)16/h7,11H,4-6,8H2,1-3H3 |
| InChIKey | WDJWKQWNHZHJRU-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 59.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.31 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |