C12H19N7O2 — CID 753811
methyl 2-[cyano-[4-(ethylamino)-6-(propan-2-ylamino)-1,3,5-triazin-2-yl]amino]acetate (PubChem CID 753811) has the molecular formula C12H19N7O2 and a molecular weight of 293.33 g/mol. Its IUPAC name is methyl 2-[cyano-[4-(ethylamino)-6-(propan-2-ylamino)-1,3,5-triazin-2-yl]amino]acetate.
| Compound Name | methyl 2-[cyano-[4-(ethylamino)-6-(propan-2-ylamino)-1,3,5-triazin-2-yl]amino]acetate |
|---|---|
| PubChem CID | 753811 |
| Molecular Formula | C12H19N7O2 |
| Molecular Weight | 293.33 g/mol |
| Exact Mass | 293.16 |
| IUPAC Name | methyl 2-[cyano-[4-(ethylamino)-6-(propan-2-ylamino)-1,3,5-triazin-2-yl]amino]acetate |
| SMILES | CCNc1nc(NC(C)C)nc(N(C#N)CC(=O)OC)n1 |
| InChI | InChI=1S/C12H19N7O2/c1-5-14-10-16-11(15-8(2)3)18-12(17-10)19(7-13)6-9(20)21-4/h8H,5-6H2,1-4H3,(H2,14,15,16,17,18) |
| InChIKey | GTSYVVADYACKST-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 116.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.33 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|