About 3-[(1-propan-2-ylpyrazol-3-yl)methyl]-5-propyl-1,3,4-oxadiazol-2-one
3-[(1-propan-2-ylpyrazol-3-yl)methyl]-5-propyl-1,3,4-oxadiazol-2-one (PubChem CID 75381250) has the molecular formula C12H18N4O2
and a molecular weight of 250.30 g/mol. Its IUPAC name is 3-[(1-propan-2-ylpyrazol-3-yl)methyl]-5-propyl-1,3,4-oxadiazol-2-one.
Molecular Properties
| Compound Name | 3-[(1-propan-2-ylpyrazol-3-yl)methyl]-5-propyl-1,3,4-oxadiazol-2-one |
| PubChem CID | 75381250 |
| Molecular Formula | C12H18N4O2 |
| Molecular Weight | 250.30 g/mol |
| Exact Mass | 250.14 |
| IUPAC Name | 3-[(1-propan-2-ylpyrazol-3-yl)methyl]-5-propyl-1,3,4-oxadiazol-2-one |
| SMILES | CCCc1nn(Cc2ccn(C(C)C)n2)c(=O)o1 |
| InChI | InChI=1S/C12H18N4O2/c1-4-5-11-14-16(12(17)18-11)8-10-6-7-15(13-10)9(2)3/h6-7,9H,4-5,8H2,1-3H3 |
| InChIKey | KQTOZKHVECBSFR-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 65.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.30 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-[(1-propan-2-ylpyrazol-3-yl)methyl]-5-propyl-1,3,4-oxadiazol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(1-propan-2-ylpyrazol-3-yl)methyl]-5-propyl-1,3,4-oxadiazol-2-one?
The IUPAC name of 3-[(1-propan-2-ylpyrazol-3-yl)methyl]-5-propyl-1,3,4-oxadiazol-2-one (CID 75381250) is 3-[(1-propan-2-ylpyrazol-3-yl)methyl]-5-propyl-1,3,4-oxadiazol-2-one.
What is the SMILES notation for 3-[(1-propan-2-ylpyrazol-3-yl)methyl]-5-propyl-1,3,4-oxadiazol-2-one?
The canonical SMILES for 3-[(1-propan-2-ylpyrazol-3-yl)methyl]-5-propyl-1,3,4-oxadiazol-2-one is CCCc1nn(Cc2ccn(C(C)C)n2)c(=O)o1.
What is the InChIKey of 3-[(1-propan-2-ylpyrazol-3-yl)methyl]-5-propyl-1,3,4-oxadiazol-2-one?
The InChIKey is KQTOZKHVECBSFR-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18N4O2/c1-4-5-11-14-16(12(17)18-11)8-10-6-7-15(13-10)9(2)3/h6-7,9H,4-5,8H2,1-3H3.
What are the key properties of 3-[(1-propan-2-ylpyrazol-3-yl)methyl]-5-propyl-1,3,4-oxadiazol-2-one?
3-[(1-propan-2-ylpyrazol-3-yl)methyl]-5-propyl-1,3,4-oxadiazol-2-one has a molecular weight of 250.30 g/mol, XLogP of 1.61, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(1-propan-2-ylpyrazol-3-yl)methyl]-5-propyl-1,3,4-oxadiazol-2-one is sourced from PubChem (CID 75381250), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).