C13H11Cl2N3O2 — CID 75381423
N-[2-[(3,5-dichloro-2-pyridinyl)oxy]ethyl]pyridine-4-carboxamide (PubChem CID 75381423) has the molecular formula C13H11Cl2N3O2 and a molecular weight of 312.16 g/mol. Its IUPAC name is N-[2-[(3,5-dichloro-2-pyridinyl)oxy]ethyl]pyridine-4-carboxamide.
| Compound Name | N-[2-[(3,5-dichloro-2-pyridinyl)oxy]ethyl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 75381423 |
| Molecular Formula | C13H11Cl2N3O2 |
| Molecular Weight | 312.16 g/mol |
| Exact Mass | 311.02 |
| IUPAC Name | N-[2-[(3,5-dichloro-2-pyridinyl)oxy]ethyl]pyridine-4-carboxamide |
| SMILES | O=C(NCCOc1ncc(Cl)cc1Cl)c1ccncc1 |
| InChI | InChI=1S/C13H11Cl2N3O2/c14-10-7-11(15)13(18-8-10)20-6-5-17-12(19)9-1-3-16-4-2-9/h1-4,7-8H,5-6H2,(H,17,19) |
| InChIKey | OZTACLVHSNONRV-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.16 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|