C14H14F2N4O2S — CID 75381654
N-[1-(3-cyanopropyl)pyrazol-3-yl]-2,5-difluoro-4-methylbenzenesulfonamide (PubChem CID 75381654) has the molecular formula C14H14F2N4O2S and a molecular weight of 340.36 g/mol. Its IUPAC name is N-[1-(3-cyanopropyl)pyrazol-3-yl]-2,5-difluoro-4-methylbenzenesulfonamide.
| Compound Name | N-[1-(3-cyanopropyl)pyrazol-3-yl]-2,5-difluoro-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 75381654 |
| Molecular Formula | C14H14F2N4O2S |
| Molecular Weight | 340.36 g/mol |
| Exact Mass | 340.08 |
| IUPAC Name | N-[1-(3-cyanopropyl)pyrazol-3-yl]-2,5-difluoro-4-methylbenzenesulfonamide |
| SMILES | Cc1cc(F)c(S(=O)(=O)Nc2ccn(CCCC#N)n2)cc1F |
| InChI | InChI=1S/C14H14F2N4O2S/c1-10-8-12(16)13(9-11(10)15)23(21,22)19-14-4-7-20(18-14)6-3-2-5-17/h4,7-9H,2-3,6H2,1H3,(H,18,19) |
| InChIKey | WAGMXBPDFLZSKD-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 87.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.36 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|