C18H25N5 — CID 75381843
5-[3-[(3,5-dimethyl-1,2,4-triazol-1-yl)methyl]anilino]-2,2-dimethylpentanenitrile (PubChem CID 75381843) has the molecular formula C18H25N5 and a molecular weight of 311.43 g/mol. Its IUPAC name is 5-[3-[(3,5-dimethyl-1,2,4-triazol-1-yl)methyl]anilino]-2,2-dimethylpentanenitrile.
| Compound Name | 5-[3-[(3,5-dimethyl-1,2,4-triazol-1-yl)methyl]anilino]-2,2-dimethylpentanenitrile |
|---|---|
| PubChem CID | 75381843 |
| Molecular Formula | C18H25N5 |
| Molecular Weight | 311.43 g/mol |
| Exact Mass | 311.21 |
| IUPAC Name | 5-[3-[(3,5-dimethyl-1,2,4-triazol-1-yl)methyl]anilino]-2,2-dimethylpentanenitrile |
| SMILES | Cc1nc(C)n(Cc2cccc(NCCCC(C)(C)C#N)c2)n1 |
| InChI | InChI=1S/C18H25N5/c1-14-21-15(2)23(22-14)12-16-7-5-8-17(11-16)20-10-6-9-18(3,4)13-19/h5,7-8,11,20H,6,9-10,12H2,1-4H3 |
| InChIKey | VDIQXRNTEKZNFG-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 66.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.43 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|