C17H23ClF3N3O — CID 75382245
N-[3-[4-[(4-chlorophenyl)methyl]-1,4-diazepan-1-yl]propyl]-2,2,2-trifluoroacetamide (PubChem CID 75382245) has the molecular formula C17H23ClF3N3O and a molecular weight of 377.84 g/mol. Its IUPAC name is N-[3-[4-[(4-chlorophenyl)methyl]-1,4-diazepan-1-yl]propyl]-2,2,2-trifluoroacetamide.
| Compound Name | N-[3-[4-[(4-chlorophenyl)methyl]-1,4-diazepan-1-yl]propyl]-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 75382245 |
| Molecular Formula | C17H23ClF3N3O |
| Molecular Weight | 377.84 g/mol |
| Exact Mass | 377.15 |
| IUPAC Name | N-[3-[4-[(4-chlorophenyl)methyl]-1,4-diazepan-1-yl]propyl]-2,2,2-trifluoroacetamide |
| SMILES | O=C(NCCCN1CCCN(Cc2ccc(Cl)cc2)CC1)C(F)(F)F |
| InChI | InChI=1S/C17H23ClF3N3O/c18-15-5-3-14(4-6-15)13-24-10-2-9-23(11-12-24)8-1-7-22-16(25)17(19,20)21/h3-6H,1-2,7-13H2,(H,22,25) |
| InChIKey | VSLTYDMVGDVADD-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.84 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|