C15H22N4O3S — CID 75382838
1-(2,1,3-benzoxadiazol-4-ylsulfonyl)-N,N-diethylpiperidin-4-amine (PubChem CID 75382838) has the molecular formula C15H22N4O3S and a molecular weight of 338.43 g/mol. Its IUPAC name is 1-(2,1,3-benzoxadiazol-4-ylsulfonyl)-N,N-diethylpiperidin-4-amine.
| Compound Name | 1-(2,1,3-benzoxadiazol-4-ylsulfonyl)-N,N-diethylpiperidin-4-amine |
|---|---|
| PubChem CID | 75382838 |
| Molecular Formula | C15H22N4O3S |
| Molecular Weight | 338.43 g/mol |
| Exact Mass | 338.14 |
| IUPAC Name | 1-(2,1,3-benzoxadiazol-4-ylsulfonyl)-N,N-diethylpiperidin-4-amine |
| SMILES | CCN(CC)C1CCN(S(=O)(=O)c2cccc3nonc23)CC1 |
| InChI | InChI=1S/C15H22N4O3S/c1-3-18(4-2)12-8-10-19(11-9-12)23(20,21)14-7-5-6-13-15(14)17-22-16-13/h5-7,12H,3-4,8-11H2,1-2H3 |
| InChIKey | PRRIYLIGAOXANY-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 79.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.43 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |