C14H20BrN3O2 — CID 75382992
3-[[2-(4-bromoanilino)-2-oxoethyl]amino]-N,N-dimethylbutanamide (PubChem CID 75382992) has the molecular formula C14H20BrN3O2 and a molecular weight of 342.24 g/mol. Its IUPAC name is 3-[[2-(4-bromoanilino)-2-oxoethyl]amino]-N,N-dimethylbutanamide.
| Compound Name | 3-[[2-(4-bromoanilino)-2-oxoethyl]amino]-N,N-dimethylbutanamide |
|---|---|
| PubChem CID | 75382992 |
| Molecular Formula | C14H20BrN3O2 |
| Molecular Weight | 342.24 g/mol |
| Exact Mass | 341.07 |
| IUPAC Name | 3-[[2-(4-bromoanilino)-2-oxoethyl]amino]-N,N-dimethylbutanamide |
| SMILES | CC(CC(=O)N(C)C)NCC(=O)Nc1ccc(Br)cc1 |
| InChI | InChI=1S/C14H20BrN3O2/c1-10(8-14(20)18(2)3)16-9-13(19)17-12-6-4-11(15)5-7-12/h4-7,10,16H,8-9H2,1-3H3,(H,17,19) |
| InChIKey | GPLYIHBRPPZMIV-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.24 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |