About [5-(trifluoromethyl)-1,3-benzoxazol-2-yl]methyl 5-ethyl-1,3-oxazole-4-carboxylate
[5-(trifluoromethyl)-1,3-benzoxazol-2-yl]methyl 5-ethyl-1,3-oxazole-4-carboxylate (PubChem CID 75383867) has the molecular formula C15H11F3N2O4
and a molecular weight of 340.26 g/mol. Its IUPAC name is [5-(trifluoromethyl)-1,3-benzoxazol-2-yl]methyl 5-ethyl-1,3-oxazole-4-carboxylate.
Molecular Properties
| Compound Name | [5-(trifluoromethyl)-1,3-benzoxazol-2-yl]methyl 5-ethyl-1,3-oxazole-4-carboxylate |
| PubChem CID | 75383867 |
| Molecular Formula | C15H11F3N2O4 |
| Molecular Weight | 340.26 g/mol |
| Exact Mass | 340.07 |
| IUPAC Name | [5-(trifluoromethyl)-1,3-benzoxazol-2-yl]methyl 5-ethyl-1,3-oxazole-4-carboxylate |
| SMILES | CCc1ocnc1C(=O)OCc1nc2cc(C(F)(F)F)ccc2o1 |
| InChI | InChI=1S/C15H11F3N2O4/c1-2-10-13(19-7-23-10)14(21)22-6-12-20-9-5-8(15(16,17)18)3-4-11(9)24-12/h3-5,7H,2,6H2,1H3 |
| InChIKey | QCRWMRIDDMEVSA-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 78.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 340.26 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [5-(trifluoromethyl)-1,3-benzoxazol-2-yl]methyl 5-ethyl-1,3-oxazole-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-(trifluoromethyl)-1,3-benzoxazol-2-yl]methyl 5-ethyl-1,3-oxazole-4-carboxylate?
The IUPAC name of [5-(trifluoromethyl)-1,3-benzoxazol-2-yl]methyl 5-ethyl-1,3-oxazole-4-carboxylate (CID 75383867) is [5-(trifluoromethyl)-1,3-benzoxazol-2-yl]methyl 5-ethyl-1,3-oxazole-4-carboxylate.
What is the SMILES notation for [5-(trifluoromethyl)-1,3-benzoxazol-2-yl]methyl 5-ethyl-1,3-oxazole-4-carboxylate?
The canonical SMILES for [5-(trifluoromethyl)-1,3-benzoxazol-2-yl]methyl 5-ethyl-1,3-oxazole-4-carboxylate is CCc1ocnc1C(=O)OCc1nc2cc(C(F)(F)F)ccc2o1.
What is the InChIKey of [5-(trifluoromethyl)-1,3-benzoxazol-2-yl]methyl 5-ethyl-1,3-oxazole-4-carboxylate?
The InChIKey is QCRWMRIDDMEVSA-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H11F3N2O4/c1-2-10-13(19-7-23-10)14(21)22-6-12-20-9-5-8(15(16,17)18)3-4-11(9)24-12/h3-5,7H,2,6H2,1H3.
What are the key properties of [5-(trifluoromethyl)-1,3-benzoxazol-2-yl]methyl 5-ethyl-1,3-oxazole-4-carboxylate?
[5-(trifluoromethyl)-1,3-benzoxazol-2-yl]methyl 5-ethyl-1,3-oxazole-4-carboxylate has a molecular weight of 340.26 g/mol, XLogP of 3.75, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [5-(trifluoromethyl)-1,3-benzoxazol-2-yl]methyl 5-ethyl-1,3-oxazole-4-carboxylate is sourced from PubChem (CID 75383867), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).