C18H17F2N3 — CID 75384284
1-(3-fluorophenyl)-N-[(4-fluorophenyl)methyl]-1-(1-methylpyrazol-4-yl)methanamine (PubChem CID 75384284) has the molecular formula C18H17F2N3 and a molecular weight of 313.35 g/mol. Its IUPAC name is 1-(3-fluorophenyl)-N-[(4-fluorophenyl)methyl]-1-(1-methylpyrazol-4-yl)methanamine.
| Compound Name | 1-(3-fluorophenyl)-N-[(4-fluorophenyl)methyl]-1-(1-methylpyrazol-4-yl)methanamine |
|---|---|
| PubChem CID | 75384284 |
| Molecular Formula | C18H17F2N3 |
| Molecular Weight | 313.35 g/mol |
| Exact Mass | 313.14 |
| IUPAC Name | 1-(3-fluorophenyl)-N-[(4-fluorophenyl)methyl]-1-(1-methylpyrazol-4-yl)methanamine |
| SMILES | Cn1cc(C(NCc2ccc(F)cc2)c2cccc(F)c2)cn1 |
| InChI | InChI=1S/C18H17F2N3/c1-23-12-15(11-22-23)18(14-3-2-4-17(20)9-14)21-10-13-5-7-16(19)8-6-13/h2-9,11-12,18,21H,10H2,1H3 |
| InChIKey | GNZIZVDCFNFBRP-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.35 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |