About 5-[[(2-methyl-3,4-dihydro-1H-naphthalen-2-yl)amino]methyl]thiophene-3-carboxamide
5-[[(2-methyl-3,4-dihydro-1H-naphthalen-2-yl)amino]methyl]thiophene-3-carboxamide (PubChem CID 75384467) has the molecular formula C17H20N2OS
and a molecular weight of 300.43 g/mol. Its IUPAC name is 5-[[(2-methyl-3,4-dihydro-1H-naphthalen-2-yl)amino]methyl]thiophene-3-carboxamide.
Molecular Properties
| Compound Name | 5-[[(2-methyl-3,4-dihydro-1H-naphthalen-2-yl)amino]methyl]thiophene-3-carboxamide |
| PubChem CID | 75384467 |
| Molecular Formula | C17H20N2OS |
| Molecular Weight | 300.43 g/mol |
| Exact Mass | 300.13 |
| IUPAC Name | 5-[[(2-methyl-3,4-dihydro-1H-naphthalen-2-yl)amino]methyl]thiophene-3-carboxamide |
| SMILES | CC1(NCc2cc(C(N)=O)cs2)CCc2ccccc2C1 |
| InChI | InChI=1S/C17H20N2OS/c1-17(7-6-12-4-2-3-5-13(12)9-17)19-10-15-8-14(11-21-15)16(18)20/h2-5,8,11,19H,6-7,9-10H2,1H3,(H2,18,20) |
| InChIKey | KUJBNTCQUPZSNK-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.43 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-[[(2-methyl-3,4-dihydro-1H-naphthalen-2-yl)amino]methyl]thiophene-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[[(2-methyl-3,4-dihydro-1H-naphthalen-2-yl)amino]methyl]thiophene-3-carboxamide?
The IUPAC name of 5-[[(2-methyl-3,4-dihydro-1H-naphthalen-2-yl)amino]methyl]thiophene-3-carboxamide (CID 75384467) is 5-[[(2-methyl-3,4-dihydro-1H-naphthalen-2-yl)amino]methyl]thiophene-3-carboxamide.
What is the SMILES notation for 5-[[(2-methyl-3,4-dihydro-1H-naphthalen-2-yl)amino]methyl]thiophene-3-carboxamide?
The canonical SMILES for 5-[[(2-methyl-3,4-dihydro-1H-naphthalen-2-yl)amino]methyl]thiophene-3-carboxamide is CC1(NCc2cc(C(N)=O)cs2)CCc2ccccc2C1.
What is the InChIKey of 5-[[(2-methyl-3,4-dihydro-1H-naphthalen-2-yl)amino]methyl]thiophene-3-carboxamide?
The InChIKey is KUJBNTCQUPZSNK-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H20N2OS/c1-17(7-6-12-4-2-3-5-13(12)9-17)19-10-15-8-14(11-21-15)16(18)20/h2-5,8,11,19H,6-7,9-10H2,1H3,(H2,18,20).
What are the key properties of 5-[[(2-methyl-3,4-dihydro-1H-naphthalen-2-yl)amino]methyl]thiophene-3-carboxamide?
5-[[(2-methyl-3,4-dihydro-1H-naphthalen-2-yl)amino]methyl]thiophene-3-carboxamide has a molecular weight of 300.43 g/mol, XLogP of 2.88, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[[(2-methyl-3,4-dihydro-1H-naphthalen-2-yl)amino]methyl]thiophene-3-carboxamide is sourced from PubChem (CID 75384467), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).